| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C/C(=N\NC(=[NH2+])S[C@H]1CC(=O)N(C1=O)c2ccc(cc2)OC)/C=C/c3ccc(cc3)N(C)C |
| Molar mass | 466.19129 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 8.20852 |
| Number of basis functions | 555 |
| Zero Point Vibrational Energy | 0.534396 |
| InChI | InChI=1/C24H28N5O3S/c1-16(5-6-17-7-9-18(10-8-17)28(2)3)26-27-24(25)33-21-15-22(30)29(23(21)31)19-11-13-20(32-4)14-12-19/h5-14,21,27H,15,25H2,1-4H3/b6-5?,26-16+/t21-/m0/s1 |
| Number of occupied orbitals | 123 |
| Energy at 0K | -1818.738681 |
| Input SMILES | COc1ccc(cc1)N1C(=O)C[C@@H](C1=O)SC(=[NH2+])N/N=C(/C=C/c1ccc(cc1)N(C)C)\C |
| Number of orbitals | 555 |
| Number of virtual orbitals | 432 |
| Standard InChI | InChI=1S/C24H28N5O3S/c1-16(5-6-17-7-9-18(10-8-17)28(2)3)26-27-24(25)33-21-15-22(30)29(23(21)31)19-11-13-20(32-4)14-12-19/h5-14,21,27H,15,25H2,1-4H3/b6-5?,26-16+/t21-/m0/s1 |
| Total Energy | -1818.707494 |
| Entropy | 3.420023D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1818.706549 |
| Standard InChI Key | InChIKey=IJDFIMMMOJQBIQ-UTBOZZAUSA-N |
| Final Isomeric SMILES | CO[C]1[CH][CH][C]([CH][CH]1)N2C(=O)C[C@H](S[C](N)N\N=C(C)\C=C[C]3[CH][CH][C]([CH][CH]3)N(C)C)C2=O |
| SMILES | CO[C]1[CH][CH][C]([CH][CH]1)N1C(=O)C[C@@H](C1=O)S[C]([NH]/N=[C]([CH]=[CH][C]1[CH][CH][C]([CH][CH]1)N(C)C)\C)[NH2] |
| Gibbs energy | -1818.808517 |
| Thermal correction to Energy | 0.565583 |
| Thermal correction to Enthalpy | 0.566527 |
| Thermal correction to Gibbs energy | 0.464559 |