| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@]1(c2cccc(c2C(=O)C3=C([C@@]4([C@H]([C@H]([C@@H]31)O)[C@@H](C(=O)/C(=C(/N)\O)/C4=O)N(C)C)O)O)O)O |
| Molar mass | 460.14818 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.57861 |
| Number of basis functions | 543 |
| Zero Point Vibrational Energy | 0.488307 |
| InChI | InChI=1/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25,28-29,31-33H,23H2,1-3H3/t12-,13+,14+,17+,21+,22-/m1/s1 |
| Number of occupied orbitals | 121 |
| Energy at 0K | -1629.193842 |
| Input SMILES | CN([C@@H]1C(=O)/C(=C(\O)/N)/C(=O)[C@]2([C@@H]1[C@@H](O)[C@H]1C(=C2O)C(=O)c2c([C@]1(C)O)cccc2O)O)C |
| Number of orbitals | 543 |
| Number of virtual orbitals | 422 |
| Standard InChI | InChI=1S/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25,28-29,31-33H,23H2,1-3H3/t12-,13+,14+,17+,21+,22-/m1/s1 |
| Total Energy | -1629.165733 |
| Entropy | 2.863089D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1629.164789 |
| Standard InChI Key | InChIKey=PLGXKXKEEFTXOQ-PEWMVLIJSA-N |
| Final Isomeric SMILES | CN(C)[C@H]1[C@H]2[C@@H](O)[C@H]3C(=C(O)[C@@]2(O)[C]([O])[C]([C](N)O)C1=O)C(=O)[C]4[C](O)[CH][CH][CH][C]4[C@]3(C)O |
| SMILES | CN([C@@H]1C(=O)[C]([C]([NH2])O)[C]([O])[C@]2([C@@H]1[C@@H](O)[C@H]1C(=C2O)C(=O)[C]2[C]([CH][CH][CH][C]2O)[C@]1(C)O)O)C |
| Gibbs energy | -1629.250152 |
| Thermal correction to Energy | 0.516416 |
| Thermal correction to Enthalpy | 0.51736 |
| Thermal correction to Gibbs energy | 0.431997 |