| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@H](C(=O)N[C@H](C)C(=O)[O-])NC(=O)[C@H](CC1=c2ccccc2=[NH+]C1)N3C(=O)[C@H]4C=CC=CC4=NC3=O |
| Molar mass | 491.18048 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 8.72961 |
| Number of basis functions | 590 |
| Zero Point Vibrational Energy | 0.51999 |
| InChI | InChI=1/C25H25N5O6/c1-13(21(31)28-14(2)24(34)35)27-22(32)20(11-15-12-26-18-9-5-3-7-16(15)18)30-23(33)17-8-4-6-10-19(17)29-25(30)36/h3-10,13-14,17,20,26H,11-12H2,1-2H3,(H,27,32)(H,28,31)/t13-,14+,17-,20-/m0/s1/f/h27-28H |
| Number of occupied orbitals | 129 |
| Energy at 0K | -1682.156984 |
| Input SMILES | C[C@@H](C(=O)N[C@@H](C(=O)[O-])C)NC(=O)[C@@H](N1C(=O)N=C2[C@@H](C1=O)C=CC=C2)CC1=c2ccccc2=[NH+]C1 |
| Number of orbitals | 590 |
| Number of virtual orbitals | 461 |
| Standard InChI | InChI=1S/C25H25N5O6/c1-13(21(31)28-14(2)24(34)35)27-22(32)20(11-15-12-26-18-9-5-3-7-16(15)18)30-23(33)17-8-4-6-10-19(17)29-25(30)36/h3-10,13-14,17,20,26H,11-12H2,1-2H3,(H,27,32)(H,28,31)/t13-,14+,17-,20-/m0/s1 |
| Total Energy | -1682.126461 |
| Entropy | 3.214959D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1682.125516 |
| Standard InChI Key | InChIKey=MLQBGSHWHHXNQR-ACNBBOPNSA-N |
| Final Isomeric SMILES | C[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C[C]1CN[C]2[CH][CH]C=C[C]12)N3C(=O)N=C4C=CC=C[C@@H]4C3=O)[C]([O])[O] |
| SMILES | O=C([C@@H](N1C(=O)N=[C]2[CH]=CC=C[C@@H]2C1=O)C[C]1[C]2[CH]=[CH][CH][CH][C]2NC1)N[C@H]([C]([NH][C@@H]([C]([O])[O])C)=O)C |
| Gibbs energy | -1682.22137 |
| Thermal correction to Energy | 0.550513 |
| Thermal correction to Enthalpy | 0.551458 |
| Thermal correction to Gibbs energy | 0.455604 |