| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@H]1c2c(s/c(=N\C(=O)C[NH+](C)C)/[nH]2)C[C@]3([C@H]1[C@H]([C@H](CC3)[C@H](C)C(=O)N4CCCC4)O)C |
| Molar mass | 465.28994 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.41808 |
| Number of basis functions | 566 |
| Zero Point Vibrational Energy | 0.698613 |
| InChI | InChI=1/C24H41N4O3S/c1-14(22(31)28-10-6-7-11-28)16-8-9-24(3)12-17-20(15(2)19(24)21(16)30)26-23(32-17)25-18(29)13-27(4)5/h14-17,19-21,27,30H,6-13H2,1-5H3,(H,25,26,29)/t14-,15-,16+,17-,19+,20-,21-,24-/m0/s1/f/h26H |
| Number of occupied orbitals | 126 |
| Energy at 0K | -1771.732673 |
| Input SMILES | C[NH+](CC(=O)/N=c\1/[nH]c2c(s1)C[C@]1([C@H]([C@@H]2C)[C@@H](O)[C@H](CC1)[C@@H](C(=O)N1CCCC1)C)C)C |
| Number of orbitals | 566 |
| Number of virtual orbitals | 440 |
| Standard InChI | InChI=1S/C24H41N4O3S/c1-14(22(31)28-10-6-7-11-28)16-8-9-24(3)12-17-20(15(2)19(24)21(16)30)26-23(32-17)25-18(29)13-27(4)5/h14-17,19-21,27,30H,6-13H2,1-5H3,(H,25,26,29)/t14-,15-,16+,17-,19+,20-,21-,24-/m0/s1 |
| Total Energy | -1771.701706 |
| Entropy | 3.203756D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1771.700762 |
| Standard InChI Key | InChIKey=PZKVBQLDGGKWCP-JHZLWZBJSA-N |
| Final Isomeric SMILES | C[C@@H]1[C@@H]2N[C]([N]C(=O)C[NH](C)C)S[C@H]2C[C@]3(C)CC[C@@H]([C@H](O)[C@@H]13)[C@H](C)C(=O)N4CCCC4 |
| SMILES | C[NH](C[C]([N][C]1[NH][C@@H]2[C@@H](S1)C[C@]1([C@H]([C@@H]2C)[C@@H](O)[C@H](CC1)[C@@H](C(=O)N1CCCC1)C)C)=O)C |
| Gibbs energy | -1771.796282 |
| Thermal correction to Energy | 0.72958 |
| Thermal correction to Enthalpy | 0.730524 |
| Thermal correction to Gibbs energy | 0.635004 |