| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@H]1c2c(sc([nH+]2)NCC=C)C[C@]3([C@H]1[C@H]([C@@H](CC3)[C@H](C)C(=O)NCCN4CCOCC4)O)C |
| Molar mass | 477.28994 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.59684 |
| Number of basis functions | 581 |
| Zero Point Vibrational Energy | 0.701635 |
| InChI | InChI=1/C25H41N4O3S/c1-5-8-27-24-28-21-17(3)20-22(30)18(6-7-25(20,4)15-19(21)33-24)16(2)23(31)26-9-10-29-11-13-32-14-12-29/h5,16-18,20,22,27-28,30H,1,6-15H2,2-4H3,(H,26,31)/t16-,17-,18-,20+,22-,25-/m0/s1/f/h26H |
| Number of occupied orbitals | 129 |
| Energy at 0K | -1809.554579 |
| Input SMILES | C=CCNc1sc2c([nH+]1)[C@@H](C)[C@H]1[C@@](C2)(C)CC[C@H]([C@@H]1O)[C@@H](C(=O)NCCN1CCOCC1)C |
| Number of orbitals | 581 |
| Number of virtual orbitals | 452 |
| Standard InChI | InChI=1S/C25H41N4O3S/c1-5-8-27-24-28-21-17(3)20-22(30)18(6-7-25(20,4)15-19(21)33-24)16(2)23(31)26-9-10-29-11-13-32-14-12-29/h5,16-18,20,22,27-28,30H,1,6-15H2,2-4H3,(H,26,31)/t16-,17-,18-,20+,22-,25-/m0/s1 |
| Total Energy | -1809.522194 |
| Entropy | 3.406104D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1809.52125 |
| Standard InChI Key | InChIKey=RMKAWVXADKBSBR-JCTLWEGCSA-N |
| Final Isomeric SMILES | C[C@@H]([C@@H]1CC[C@@]2(C)CC3=C(N[C](NCC=C)S3)[C@@H](C)[C@@H]2[C@H]1O)C(=O)NCCN4CCOCC4 |
| SMILES | C=CC[NH][C]1[NH]C2=C(S1)C[C@]1([C@H]([C@@H]2C)[C@@H](O)[C@@H](CC1)[C@@H](C(=O)NCCN1CCOCC1)C)C |
| Gibbs energy | -1809.622803 |
| Thermal correction to Energy | 0.73402 |
| Thermal correction to Enthalpy | 0.734965 |
| Thermal correction to Gibbs energy | 0.633411 |