| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@H]1c2c(sc(n2)NS(=O)(=O)c3ccc(cc3)Cl)C[C@]4([C@H]1[C@H]([C@H](CC4)[C@H](C)C(=O)N5CCCC5)O)C |
| Molar mass | 551.16793 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.78134 |
| Number of basis functions | 620 |
| Zero Point Vibrational Energy | 0.624146 |
| InChI | InChI=1/C26H34ClN3O4S2/c1-15(24(32)30-12-4-5-13-30)19-10-11-26(3)14-20-22(16(2)21(26)23(19)31)28-25(35-20)29-36(33,34)18-8-6-17(27)7-9-18/h6-9,15-16,19,21,23,31H,4-5,10-14H2,1-3H3,(H,28,29)/t15-,16-,19+,21+,23-,26-/m0/s1/f/h29H |
| Number of occupied orbitals | 146 |
| Energy at 0K | -2720.983334 |
| Input SMILES | C[C@H](C(=O)N1CCCC1)[C@H]1CC[C@@]2([C@@H]([C@H]1O)[C@H](C)c1c(C2)sc(n1)NS(=O)(=O)c1ccc(cc1)Cl)C |
| Number of orbitals | 620 |
| Number of virtual orbitals | 474 |
| Standard InChI | InChI=1S/C26H34ClN3O4S2/c1-15(24(32)30-12-4-5-13-30)19-10-11-26(3)14-20-22(16(2)21(26)23(19)31)28-25(35-20)29-36(33,34)18-8-6-17(27)7-9-18/h6-9,15-16,19,21,23,31H,4-5,10-14H2,1-3H3,(H,28,29)/t15-,16-,19+,21+,23-,26-/m0/s1 |
| Total Energy | -2720.95092 |
| Entropy | 3.387624D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2720.949976 |
| Standard InChI Key | InChIKey=QUKVCORRKYQZQP-QXLMHGPXSA-N |
| Final Isomeric SMILES | C[C@@H]([C@H]1CC[C@@]2(C)Cc3sc(N[S](=O)(=O)[C]4[CH][CH][C](Cl)[CH][CH]4)nc3[C@@H](C)[C@@H]2[C@H]1O)C(=O)N5CCCC5 |
| SMILES | C[C@H](C(=O)N1CCCC1)[C@H]1CC[C@@]2([C@@H]([C@H]1O)[C@H](C)C1=C(C2)S[C](=N1)NS(=O)(=O)[C]1[CH][CH][C]([CH][CH]1)Cl)C |
| Gibbs energy | -2721.050978 |
| Thermal correction to Energy | 0.65656 |
| Thermal correction to Enthalpy | 0.657504 |
| Thermal correction to Gibbs energy | 0.556502 |