| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@@H]1c2c(sc(n2)Nc3cccnc3)C[C@@]4([C@H]1[C@H]([C@@H](CC4)[C@H](C)C(=O)N(C)CC=C)O)C |
| Molar mass | 454.24025 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.08202 |
| Number of basis functions | 552 |
| Zero Point Vibrational Energy | 0.605784 |
| InChI | InChI=1/C25H34N4O2S/c1-6-12-29(5)23(31)15(2)18-9-10-25(4)13-19-21(16(3)20(25)22(18)30)28-24(32-19)27-17-8-7-11-26-14-17/h6-8,11,14-16,18,20,22,30H,1,9-10,12-13H2,2-5H3,(H,27,28)/t15-,16-,18-,20+,22-,25+/m0/s1/f/h27H |
| Number of occupied orbitals | 122 |
| Energy at 0K | -1730.91087 |
| Input SMILES | C=CCN(C(=O)[C@H]([C@@H]1CC[C@]2([C@@H]([C@H]1O)[C@H](C)c1c(C2)sc(n1)Nc1cccnc1)C)C)C |
| Number of orbitals | 552 |
| Number of virtual orbitals | 430 |
| Standard InChI | InChI=1S/C25H34N4O2S/c1-6-12-29(5)23(31)15(2)18-9-10-25(4)13-19-21(16(3)20(25)22(18)30)28-24(32-19)27-17-8-7-11-26-14-17/h6-8,11,14-16,18,20,22,30H,1,9-10,12-13H2,2-5H3,(H,27,28)/t15-,16-,18-,20+,22-,25+/m0/s1 |
| Total Energy | -1730.880825 |
| Entropy | 3.209123D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1730.879881 |
| Standard InChI Key | InChIKey=XOPOJMZFSZNXLT-WOHOODEXSA-N |
| Final Isomeric SMILES | C[C@@H]([C@@H]1CC[C@]2(C)Cc3sc(N[C]4[CH][CH][CH][N][CH]4)nc3[C@@H](C)[C@@H]2[C@H]1O)C(=O)N(C)CC=C |
| SMILES | C=CCN(C(=O)[C@H]([C@@H]1CC[C@]2([C@@H]([C@H]1O)[C@H](C)c1c(C2)sc(n1)N[C]1[CH][CH][CH][N][CH]1)C)C)C |
| Gibbs energy | -1730.975561 |
| Thermal correction to Energy | 0.635828 |
| Thermal correction to Enthalpy | 0.636773 |
| Thermal correction to Gibbs energy | 0.541093 |