| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@]12C[C@H]([C@@]3([C@H]([C@H]1C[C@H]4[C@]2(OC(O4)(C)C)C(=O)CO)C[C@@H](C5=CC(=O)C=C[C@@]53C)F)F)O |
| Molar mass | 452.20105 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.44094 |
| Number of basis functions | 540 |
| Zero Point Vibrational Energy | 0.55659 |
| InChI | InChI=1/C24H30F2O6/c1-20(2)31-19-9-13-14-8-16(25)15-7-12(28)5-6-21(15,3)23(14,26)17(29)10-22(13,4)24(19,32-20)18(30)11-27/h5-7,13-14,16-17,19,27,29H,8-11H2,1-4H3/t13-,14+,16+,17-,19+,21+,22+,23-,24-/m1/s1 |
| Number of occupied orbitals | 120 |
| Energy at 0K | -1573.704714 |
| Input SMILES | OCC(=O)[C@@]12OC(O[C@H]1C[C@H]1[C@]2(C)C[C@@H](O)[C@@]2([C@H]1C[C@@H](C1=CC(=O)C=C[C@]21C)F)F)(C)C |
| Number of orbitals | 540 |
| Number of virtual orbitals | 420 |
| Standard InChI | InChI=1S/C24H30F2O6/c1-20(2)31-19-9-13-14-8-16(25)15-7-12(28)5-6-21(15,3)23(14,26)17(29)10-22(13,4)24(19,32-20)18(30)11-27/h5-7,13-14,16-17,19,27,29H,8-11H2,1-4H3/t13-,14+,16+,17-,19+,21+,22+,23-,24-/m1/s1 |
| Total Energy | -1573.677133 |
| Entropy | 2.813852D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1573.676189 |
| Standard InChI Key | InChIKey=FEBLZLNTKCEFIT-PXWWRVHTSA-N |
| Final Isomeric SMILES | CC1(C)O[C@H]2C[C@@H]3[C@@H]4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@]4(F)[C@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO |
| SMILES | OCC(=O)[C@@]12OC(O[C@H]1C[C@H]1[C@]2(C)C[C@@H](O)[C@@]2([C@H]1C[C@@H](C1=CC(=O)C=C[C@]21C)F)F)(C)C |
| Gibbs energy | -1573.760084 |
| Thermal correction to Energy | 0.584171 |
| Thermal correction to Enthalpy | 0.585116 |
| Thermal correction to Gibbs energy | 0.50122 |