| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@]12CC[C@H]([C@@]([C@H]1Cc3c(nc(s3)NC(=O)C(C)(C)C)[C@H]2CC(=O)N(C)CC#C)(C)CO)O |
| Molar mass | 475.25048 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.80638 |
| Number of basis functions | 573 |
| Zero Point Vibrational Energy | 0.644578 |
| InChI | InChI=1/C25H37N3O4S/c1-8-11-28(7)19(31)12-15-20-16(33-22(26-20)27-21(32)23(2,3)4)13-17-24(15,5)10-9-18(30)25(17,6)14-29/h1,15,17-18,29-30H,9-14H2,2-7H3,(H,26,27,32)/t15-,17+,18-,24-,25+/m1/s1/f/h27H |
| Number of occupied orbitals | 128 |
| Energy at 0K | -1827.845812 |
| Input SMILES | C#CCN(C(=O)C[C@@H]1c2nc(sc2C[C@H]2[C@]1(C)CC[C@H]([C@@]2(C)CO)O)NC(=O)C(C)(C)C)C |
| Number of orbitals | 573 |
| Number of virtual orbitals | 445 |
| Standard InChI | InChI=1S/C25H37N3O4S/c1-8-11-28(7)19(31)12-15-20-16(33-22(26-20)27-21(32)23(2,3)4)13-17-24(15,5)10-9-18(30)25(17,6)14-29/h1,15,17-18,29-30H,9-14H2,2-7H3,(H,26,27,32)/t15-,17+,18-,24-,25+/m1/s1 |
| Total Energy | -1827.812628 |
| Entropy | 3.310884D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1827.811684 |
| Standard InChI Key | InChIKey=ZRNHCLSTMAYUKQ-ZZFRZPPWSA-N |
| Final Isomeric SMILES | CN(CC#C)C(=O)C[C@@H]1c2nc(NC(=O)C(C)(C)C)sc2C[C@@H]3[C@](C)(CO)[C@H](O)CC[C@]13C |
| SMILES | C#CCN(C(=O)C[C@@H]1C2=C(C[C@H]3[C@]1(C)CC[C@H]([C@@]3(C)CO)O)S[C](=N2)NC(=O)C(C)(C)C)C |
| Gibbs energy | -1827.910398 |
| Thermal correction to Energy | 0.677761 |
| Thermal correction to Enthalpy | 0.678705 |
| Thermal correction to Gibbs energy | 0.579992 |