| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H](C(=O)N1CCCCCC1)OC(=O)c2cc(ccc2N3CCOCC3)S(=O)(=O)N(C)C |
| Molar mass | 467.20901 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.27304 |
| Number of basis functions | 550 |
| Zero Point Vibrational Energy | 0.592757 |
| InChI | InChI=1/C22H33N3O6S/c1-17(21(26)25-10-6-4-5-7-11-25)31-22(27)19-16-18(32(28,29)23(2)3)8-9-20(19)24-12-14-30-15-13-24/h8-9,16-17H,4-7,10-15H2,1-3H3/t17-/m1/s1 |
| Number of occupied orbitals | 125 |
| Energy at 0K | -1861.681261 |
| Input SMILES | C[C@H](C(=O)N1CCCCCC1)OC(=O)c1cc(ccc1N1CCOCC1)S(=O)(=O)N(C)C |
| Number of orbitals | 550 |
| Number of virtual orbitals | 425 |
| Standard InChI | InChI=1S/C22H33N3O6S/c1-17(21(26)25-10-6-4-5-7-11-25)31-22(27)19-16-18(32(28,29)23(2)3)8-9-20(19)24-12-14-30-15-13-24/h8-9,16-17H,4-7,10-15H2,1-3H3/t17-/m1/s1 |
| Total Energy | -1861.651339 |
| Entropy | 3.205903D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1861.650394 |
| Standard InChI Key | InChIKey=XAPVUKPRBRXIMV-QGZVFWFLSA-N |
| Final Isomeric SMILES | C[C@@H](OC(=O)[C]1[CH][C]([CH][CH][C]1N2CCOCC2)[S](=O)(=O)N(C)C)C(=O)N3CCCCCC3 |
| SMILES | C[C@H](C(=O)N1CCCCCC1)OC(=O)[C]1[CH][C]([CH][CH][C]1N1CCOCC1)S(=O)(=O)N(C)C |
| Gibbs energy | -1861.745978 |
| Thermal correction to Energy | 0.622679 |
| Thermal correction to Enthalpy | 0.623623 |
| Thermal correction to Gibbs energy | 0.52804 |