| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(C(=O)[C@H]([C@@H]3[C@@H]2CC[C@@H]4[C@@]3(CCCC4)C)Br)C |
| Molar mass | 451.18478 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.87221 |
| Number of basis functions | 507 |
| Zero Point Vibrational Energy | 0.607986 |
| InChI | InChI=1/C24H36BrO3/c1-14(7-12-19(26)27)17-10-11-18-16-9-8-15-6-4-5-13-23(15,2)20(16)21(25)22(28)24(17,18)3/h14-18,20-21H,4-13H2,1-3H3/t14-,15-,16-,17-,18+,20+,21+,23+,24-/m1/s1 |
| Number of occupied orbitals | 120 |
| Energy at 0K | -3723.6859 |
| Input SMILES | [O-]C(=O)CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)C(=O)[C@H]([C@@H]1[C@@H]2CC[C@@H]2[C@]1(C)CCCC2)Br)C |
| Number of orbitals | 507 |
| Number of virtual orbitals | 387 |
| Standard InChI | InChI=1S/C24H36BrO3/c1-14(7-12-19(26)27)17-10-11-18-16-9-8-15-6-4-5-13-23(15,2)20(16)21(25)22(28)24(17,18)3/h14-18,20-21H,4-13H2,1-3H3/t14-,15-,16-,17-,18+,20+,21+,23+,24-/m1/s1 |
| Total Energy | -3723.659887 |
| Entropy | 2.825356D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -3723.658943 |
| Standard InChI Key | InChIKey=MIBZUNYBBAZHOW-ZEEIQBFNSA-N |
| Final Isomeric SMILES | C[C@H](CC[C]([O])[O])[C@H]1CC[C@H]2[C@H]3CC[C@H]4CCCC[C@]4(C)[C@@H]3[C@H](Br)C(=O)[C@]12C |
| SMILES | C[C@@H]([C@H]1CC[C@@H]2[C@]1(C)C(=O)[C@H]([C@@H]1[C@@H]2CC[C@@H]2[C@]1(C)CCCC2)Br)CC[C]([O])[O] |
| Gibbs energy | -3723.743181 |
| Thermal correction to Energy | 0.633998 |
| Thermal correction to Enthalpy | 0.634943 |
| Thermal correction to Gibbs energy | 0.550705 |