| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@]1([C@H](C[C@H]3[C@@H]2CC[C@@H]4[C@]3(CC[C@H](C4)OC=O)C)OC=O)C |
| Molar mass | 447.27466 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.30297 |
| Number of basis functions | 558 |
| Zero Point Vibrational Energy | 0.671059 |
| InChI | InChI=1/C26H39O6/c1-16(4-9-24(29)30)20-7-8-21-19-6-5-17-12-18(31-14-27)10-11-25(17,2)22(19)13-23(32-15-28)26(20,21)3/h14-23H,4-13H2,1-3H3/t16-,17+,18-,19-,20-,21+,22+,23+,25-,26+/m1/s1 |
| Number of occupied orbitals | 122 |
| Energy at 0K | -1455.813879 |
| Input SMILES | O=CO[C@H]1C[C@H]2[C@@H]([C@H]3[C@]1(C)[C@H](CC3)[C@@H](CCC(=O)[O-])C)CC[C@@H]1[C@@]2(C)CC[C@H](C1)OC=O |
| Number of orbitals | 558 |
| Number of virtual orbitals | 436 |
| Standard InChI | InChI=1S/C26H39O6/c1-16(4-9-24(29)30)20-7-8-21-19-6-5-17-12-18(31-14-27)10-11-25(17,2)22(19)13-23(32-15-28)26(20,21)3/h14-23H,4-13H2,1-3H3/t16-,17+,18-,19-,20-,21+,22+,23+,25-,26+/m1/s1 |
| Total Energy | -1455.784179 |
| Entropy | 3.111119D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1455.783235 |
| Standard InChI Key | InChIKey=LPZSCNIUVPVZRH-WJJZXVNKSA-N |
| Final Isomeric SMILES | C[C@H](CCC([O])=O)[C@H]1CC[C@H]2[C@H]3CC[C@H]4C[C@@H](CC[C@@]4(C)[C@H]3C[C@H](OC=O)[C@@]12C)OC=O |
| SMILES | O=CO[C@H]1C[C@H]2[C@@H]([C@H]3[C@]1(C)[C@H](CC3)[C@@H](CC[C]([O])=O)C)CC[C@@H]1[C@@]2(C)CC[C@H](C1)OC=O |
| Gibbs energy | -1455.875993 |
| Thermal correction to Energy | 0.700759 |
| Thermal correction to Enthalpy | 0.701703 |
| Thermal correction to Gibbs energy | 0.608945 |