| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H](CCC1=c2ccccc2=[NH+]C1)Nc3cc4c([nH+]c3)N([C@H]([C@H]4NC(=O)C)C(=O)OC)CCC(C)C |
| Molar mass | 493.30529 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 8.54621 |
| Number of basis functions | 618 |
| Zero Point Vibrational Energy | 0.69607 |
| InChI | InChI=1/C28H39N5O3/c1-17(2)12-13-33-26(28(35)36-5)25(32-19(4)34)23-14-21(16-30-27(23)33)31-18(3)10-11-20-15-29-24-9-7-6-8-22(20)24/h6-9,14,16-18,25-26,29-31H,10-13,15H2,1-5H3,(H,32,34)/t18-,25+,26-/m1/s1/f/h32H |
| Number of occupied orbitals | 132 |
| Energy at 0K | -1578.747933 |
| Input SMILES | COC(=O)[C@@H]1N(CCC(C)C)c2c([C@@H]1NC(=O)C)cc(c[nH+]2)N[C@@H](CCC1=c2ccccc2=[NH+]C1)C |
| Number of orbitals | 618 |
| Number of virtual orbitals | 486 |
| Standard InChI | InChI=1S/C28H39N5O3/c1-17(2)12-13-33-26(28(35)36-5)25(32-19(4)34)23-14-21(16-30-27(23)33)31-18(3)10-11-20-15-29-24-9-7-6-8-22(20)24/h6-9,14,16-18,25-26,29-31H,10-13,15H2,1-5H3,(H,32,34)/t18-,25+,26-/m1/s1 |
| Total Energy | -1578.713013 |
| Entropy | 3.635586D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1578.712069 |
| Standard InChI Key | InChIKey=VNPLUBUUAMQXTB-YKQNXRHISA-N |
| Final Isomeric SMILES | COC(=O)[C@H]1[C@@H](NC(C)=O)C2=CC(=CN[C]2N1CCC(C)C)N[C@H](C)CCC3=C4C=CC=C[C]4NC3 |
| SMILES | COC(=O)[C@H]1[C@@H](NC(=O)C)[C]2[C]([N]1CCC(C)C)[NH]C=[C]([CH]=2)N[C@@H](CCC1=[C]2[CH]=[CH][CH]=[CH][C]2[NH]C1)C |
| Gibbs energy | -1578.820464 |
| Thermal correction to Energy | 0.73099 |
| Thermal correction to Enthalpy | 0.731934 |
| Thermal correction to Gibbs energy | 0.62354 |