| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H](c1ccccc1)N2[C@@H](N=C([C@@H](C2=O)[C@@H]3[C@@H]4C(=c5cc(ccc5=[NH+]4)OC)CCN3)O)O |
| Molar mass | 435.20323 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 7.89858 |
| Number of basis functions | 534 |
| Zero Point Vibrational Energy | 0.528556 |
| InChI | InChI=1/C24H27N4O4/c1-13(14-6-4-3-5-7-14)28-23(30)19(22(29)27-24(28)31)21-20-16(10-11-25-21)17-12-15(32-2)8-9-18(17)26-20/h3-9,12-13,19-21,24-26,31H,10-11H2,1-2H3,(H,27,29)/t13-,19+,20+,21-,24-/m1/s1/f/h29H |
| Number of occupied orbitals | 115 |
| Energy at 0K | -1441.080223 |
| Input SMILES | COc1ccc2=[NH+][C@H]3C(=c2c1)CCN[C@@H]3[C@H]1C(=N[C@H](N(C1=O)[C@@H](c1ccccc1)C)O)O |
| Number of orbitals | 534 |
| Number of virtual orbitals | 419 |
| Standard InChI | InChI=1S/C24H27N4O4/c1-13(14-6-4-3-5-7-14)28-23(30)19(22(29)27-24(28)31)21-20-16(10-11-25-21)17-12-15(32-2)8-9-18(17)26-20/h3-9,12-13,19-21,24-26,31H,10-11H2,1-2H3,(H,27,29)/t13-,19+,20+,21-,24-/m1/s1 |
| Total Energy | -1441.054154 |
| Entropy | 2.866141D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1441.053209 |
| Standard InChI Key | InChIKey=CATDCYYBFIALEX-AJMKPQHWSA-N |
| Final Isomeric SMILES | COC1=CC2=C3CCN[C@@H]([C@H]3N[C]2C=C1)[C@H]4C(=N[C@@H](O)N([C@H](C)[C]5[CH][CH][CH][CH][CH]5)C4=O)O |
| SMILES | CO[C]1[CH]=[CH][C]2[C]([CH]=1)=C1CCN[C@@H]([C@H]1[NH]2)[C@H]1C(=N[C@H](N(C1=O)[C@@H]([C]1[CH][CH][CH][CH][CH]1)C)O)O |
| Gibbs energy | -1441.138663 |
| Thermal correction to Energy | 0.554625 |
| Thermal correction to Enthalpy | 0.555569 |
| Thermal correction to Gibbs energy | 0.470115 |