| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1[C@H](NC2=[NH+]C(=NC(=O)[C@H]2N1)N)C |
| Molar mass | 196.11984 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.15441 |
| Number of basis functions | 238 |
| Zero Point Vibrational Energy | 0.256674 |
| InChI | InChI=1/C8H14N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h3-5,10H,1-2H3,(H4,9,11,12,13,14)/t3-,4+,5-/m0/s1/f/h11-12H,9H2 |
| Number of occupied orbitals | 52 |
| Energy at 0K | -657.755398 |
| Input SMILES | C[C@H]1NC2=[NH+]C(=NC(=O)[C@H]2N[C@H]1C)N |
| Number of orbitals | 238 |
| Number of virtual orbitals | 186 |
| Standard InChI | InChI=1S/C8H14N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h3-5,10H,1-2H3,(H4,9,11,12,13,14)/t3-,4+,5-/m0/s1 |
| Total Energy | -657.743327 |
| Entropy | 1.698575D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -657.742383 |
| Standard InChI Key | InChIKey=GSKVSSOVEGIJGM-LMVFSUKVSA-N |
| Final Isomeric SMILES | C[C@H]1N[C]2NC(=NC(=O)[C@H]2N[C@H]1C)N |
| SMILES | C[C@@H]1N[C@@H]2C(=O)N=[C]([NH2])N[C]2[NH][C@@H]1C |
| Gibbs energy | -657.793026 |
| Thermal correction to Energy | 0.268745 |
| Thermal correction to Enthalpy | 0.269689 |
| Thermal correction to Gibbs energy | 0.219046 |