| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1[C@H](O[C@@H](C(=S)N1S(=O)(=O)c2ccc(cc2)Oc3ccncc3)CNO)C |
| Molar mass | 423.09226 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.03658 |
| Number of basis functions | 470 |
| Zero Point Vibrational Energy | 0.415166 |
| InChI | InChI=1/C18H21N3O5S2/c1-12-13(2)25-17(11-20-22)18(27)21(12)28(23,24)16-5-3-14(4-6-16)26-15-7-9-19-10-8-15/h3-10,12-13,17,20,22H,11H2,1-2H3/t12-,13+,17+/m0/s1 |
| Number of occupied orbitals | 111 |
| Energy at 0K | -2025.931397 |
| Input SMILES | ONC[C@H]1O[C@H](C)[C@@H](N(C1=S)S(=O)(=O)c1ccc(cc1)Oc1ccncc1)C |
| Number of orbitals | 470 |
| Number of virtual orbitals | 359 |
| Standard InChI | InChI=1S/C18H21N3O5S2/c1-12-13(2)25-17(11-20-22)18(27)21(12)28(23,24)16-5-3-14(4-6-16)26-15-7-9-19-10-8-15/h3-10,12-13,17,20,22H,11H2,1-2H3/t12-,13+,17+/m0/s1 |
| Total Energy | -2025.906841 |
| Entropy | 2.824015D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2025.905897 |
| Standard InChI Key | InChIKey=WRTVMPQUJJYFOB-OGHNNQOOSA-N |
| Final Isomeric SMILES | C[C@H]1O[C@H](CNO)C(=S)N([C@H]1C)[S]([O])(=O)[C]2[CH][CH][C]([CH][CH]2)O[C]3[CH][CH][N][CH][CH]3 |
| SMILES | ONC[C@H]1O[C@H](C)[C@@H](N(C1=S)[S@@]([O])(=O)[C]1[CH][CH][C]([CH][CH]1)O[C]1[CH][CH][N][CH][CH]1)C |
| Gibbs energy | -2025.990095 |
| Thermal correction to Energy | 0.439722 |
| Thermal correction to Enthalpy | 0.440666 |
| Thermal correction to Gibbs energy | 0.356468 |