| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1CC[C@@H]([C@@H](C1)[NH2+][C@@H]2CCC[C@@H]([C@@H]2C)C)C(C)C |
| Molar mass | 266.28478 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 16.04887 |
| Number of basis functions | 357 |
| Zero Point Vibrational Energy | 0.560946 |
| InChI | InChI=1/C18H36N/c1-12(2)16-10-9-13(3)11-18(16)19-17-8-6-7-14(4)15(17)5/h12-18H,6-11,19H2,1-5H3/t13-,14-,15-,16+,17+,18+/m0/s1 |
| Number of occupied orbitals | 75 |
| Energy at 0K | -756.306841 |
| Input SMILES | C[C@H]1CC[C@@H]([C@@H](C1)[NH2+][C@@H]1CCC[C@@H]([C@@H]1C)C)C(C)C |
| Number of orbitals | 357 |
| Number of virtual orbitals | 282 |
| Standard InChI | InChI=1S/C18H36N/c1-12(2)16-10-9-13(3)11-18(16)19-17-8-6-7-14(4)15(17)5/h12-18H,6-11,19H2,1-5H3/t13-,14-,15-,16+,17+,18+/m0/s1 |
| Total Energy | -756.286894 |
| Entropy | 2.324434D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -756.28595 |
| Standard InChI Key | InChIKey=PSPSDWRJJQWUSV-SJUNHDGSSA-N |
| Final Isomeric SMILES | C[C@H]1CC[C@H](C(C)C)[C@@H](C1)[NH2][C@@H]2CCC[C@H](C)[C@@H]2C |
| SMILES | C[C@H]1CC[C@@H]([C@@H](C1)[NH2][C@@H]1CCC[C@@H]([C@@H]1C)C)C(C)C |
| Gibbs energy | -756.355253 |
| Thermal correction to Energy | 0.580893 |
| Thermal correction to Enthalpy | 0.581838 |
| Thermal correction to Gibbs energy | 0.512534 |