| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1CCC(=[NH+]C1)[C@@H](C)[C@@H]2[C@@H](C[C@@H]3[C@]2(CC[C@@H]4[C@@H]3CC=C5[C@]4(CC[C@@H](C5)OC(=O)C)C)C)OC(=O)C |
| Molar mass | 498.35833 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.22296 |
| Number of basis functions | 636 |
| Zero Point Vibrational Energy | 0.81152 |
| InChI | InChI=1/C31H48NO4/c1-18-7-10-27(32-17-18)19(2)29-28(36-21(4)34)16-26-24-9-8-22-15-23(35-20(3)33)11-13-30(22,5)25(24)12-14-31(26,29)6/h8,18-19,23-26,28-29,32H,7,9-17H2,1-6H3/t18-,19+,23-,24-,25+,26-,28+,29+,30+,31+/m0/s1 |
| Number of occupied orbitals | 136 |
| Energy at 0K | -1554.818429 |
| Input SMILES | C[C@H]1CCC(=[NH+]C1)[C@H]([C@@H]1[C@H](OC(=O)C)C[C@@H]2[C@@]1(C)CC[C@@H]1[C@@H]2CC=C2[C@@]1(C)CC[C@@H](C2)OC(=O)C)C |
| Number of orbitals | 636 |
| Number of virtual orbitals | 500 |
| Standard InChI | InChI=1S/C31H48NO4/c1-18-7-10-27(32-17-18)19(2)29-28(36-21(4)34)16-26-24-9-8-22-15-23(35-20(3)33)11-13-30(22,5)25(24)12-14-31(26,29)6/h8,18-19,23-26,28-29,32H,7,9-17H2,1-6H3/t18-,19+,23-,24-,25+,26-,28+,29+,30+,31+/m0/s1 |
| Total Energy | -1554.784666 |
| Entropy | 3.399899D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1554.783722 |
| Standard InChI Key | InChIKey=BBEMOVVVEFSJNP-CSNMDPFUSA-N |
| Final Isomeric SMILES | C[C@H]1CC[C](NC1)[C@@H](C)[C@@H]2[C@@H](C[C@H]3[C@H]4CC=C5C[C@H](CC[C@@]5(C)[C@@H]4CC[C@@]23C)OC(C)=O)OC(C)=O |
| SMILES | C[C@H]1CC[C]([NH]C1)[C@H]([C@@H]1[C@H](OC(=O)C)C[C@@H]2[C@@]1(C)CC[C@@H]1[C@@H]2CC=C2[C@@]1(C)CC[C@@H](C2)OC(=O)C)C |
| Gibbs energy | -1554.88509 |
| Thermal correction to Energy | 0.845283 |
| Thermal correction to Enthalpy | 0.846227 |
| Thermal correction to Gibbs energy | 0.744859 |