| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)[C@@H](C)Sc2nnc3n2c4ccccc4c(=O)n3CCC(C)C |
| Molar mass | 461.28245 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.73156 |
| Number of basis functions | 562 |
| Zero Point Vibrational Energy | 0.668993 |
| InChI | InChI=1/C24H39N5O2S/c1-15(2)13-14-28-22(31)18-10-6-8-12-20(18)29-23(28)26-27-24(29)32-17(4)21(30)25-19-11-7-5-9-16(19)3/h15-20H,5-14H2,1-4H3,(H,25,30)/t16-,17+,18+,19+,20+/m0/s1/f/h25H |
| Number of occupied orbitals | 125 |
| Energy at 0K | -1750.412777 |
| Input SMILES | CC(CCn1c2nnc(n2c2c(c1=O)cccc2)S[C@@H](C(=O)N[C@@H]1CCCC[C@@H]1C)C)C |
| Number of orbitals | 562 |
| Number of virtual orbitals | 437 |
| Standard InChI | InChI=1S/C24H39N5O2S/c1-15(2)13-14-28-22(31)18-10-6-8-12-20(18)29-23(28)26-27-24(29)32-17(4)21(30)25-19-11-7-5-9-16(19)3/h15-20H,5-14H2,1-4H3,(H,25,30)/t16-,17+,18+,19+,20+/m0/s1 |
| Total Energy | -1750.381803 |
| Entropy | 3.337850D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1750.380859 |
| Standard InChI Key | InChIKey=IZHVQFZQSCIXJV-OMQSBVIBSA-N |
| Final Isomeric SMILES | CC(C)CCN1[C]2[N]N=C(S[C@H](C)C(=O)N[C@@H]3CCCC[C@@H]3C)N2[C@@H]4CCCC[C@H]4C1=O |
| SMILES | CC(CCN1C(=O)[C@@H]2CCCC[C@H]2N2[C]1[N][N]=C2S[C@@H]([C]([NH][C@@H]1CCCC[C@@H]1C)=O)C)C |
| Gibbs energy | -1750.480377 |
| Thermal correction to Energy | 0.699966 |
| Thermal correction to Enthalpy | 0.70091 |
| Thermal correction to Gibbs energy | 0.601392 |