| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[C@H]1CCCC[NH+]1CCCNC(=O)C(=O)Nc2ccc3c(c2)C(=O)N(C3=O)C |
| Molar mass | 387.20323 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.72202 |
| Number of basis functions | 474 |
| Zero Point Vibrational Energy | 0.503276 |
| InChI | InChI=1/C20H27N4O4/c1-13-6-3-4-10-24(13)11-5-9-21-17(25)18(26)22-14-7-8-15-16(12-14)20(28)23(2)19(15)27/h7-8,12-13,24H,3-6,9-11H2,1-2H3,(H,21,25)(H,22,26)/t13-/m0/s1/f/h21-22H |
| Number of occupied orbitals | 103 |
| Energy at 0K | -1289.730324 |
| Input SMILES | O=C(C(=O)NCCC[NH+]1CCCC[C@@H]1C)Nc1ccc2c(c1)C(=O)N(C2=O)C |
| Number of orbitals | 474 |
| Number of virtual orbitals | 371 |
| Standard InChI | InChI=1S/C20H27N4O4/c1-13-6-3-4-10-24(13)11-5-9-21-17(25)18(26)22-14-7-8-15-16(12-14)20(28)23(2)19(15)27/h7-8,12-13,24H,3-6,9-11H2,1-2H3,(H,21,25)(H,22,26)/t13-/m0/s1 |
| Total Energy | -1289.704687 |
| Entropy | 2.944994D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1289.703743 |
| Standard InChI Key | InChIKey=CDEFGNPKCSPXBD-ZDUSSCGKSA-N |
| Final Isomeric SMILES | C[C@H]1CCCC[NH]1CCCNC(=O)C(=O)N[C]2[CH][CH][C]3[C]([CH]2)C(=O)N(C)C3=O |
| SMILES | C[C@H]1CCCC[NH]1CCC[NH][C](=O)C(=O)N[C]1[CH][CH][C]2[C]([CH]1)C(=O)N(C2=O)C |
| Gibbs energy | -1289.791548 |
| Thermal correction to Energy | 0.528912 |
| Thermal correction to Enthalpy | 0.529857 |
| Thermal correction to Gibbs energy | 0.442051 |