| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[NH+](C)[C@@H]1[C@H]2C[C@H]3Cc4c(ccc(c4C(=O)C3=C([C@]2(C(=O)C(=C1[O-])C(=O)N)O)O)O)N(C)C |
| Molar mass | 457.1849 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.6986 |
| Number of basis functions | 549 |
| Zero Point Vibrational Energy | 0.530094 |
| InChI | InChI=1/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,26-27,30,33H,7-8H2,1-4H3,(H2,24,32)/t9-,11-,17-,23-/m1/s1/f/h24H2 |
| Number of occupied orbitals | 121 |
| Energy at 0K | -1573.511476 |
| Input SMILES | C[NH+]([C@H]1C(=C(C(=O)N)C(=O)[C@]2([C@@H]1C[C@H]1Cc3c(C(=O)C1=C2O)c(O)ccc3N(C)C)O)[O-])C |
| Number of orbitals | 549 |
| Number of virtual orbitals | 428 |
| Standard InChI | InChI=1S/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,26-27,30,33H,7-8H2,1-4H3,(H2,24,32)/t9-,11-,17-,23-/m1/s1 |
| Total Energy | -1573.483269 |
| Entropy | 2.932249D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1573.482325 |
| Standard InChI Key | InChIKey=HQMSALVLHBIXLG-PYOFKWECSA-N |
| Final Isomeric SMILES | CN(C)[C]1[CH][CH][C](O)[C]2[C]([O])C3=C(O)[C@]4(O)[C@H](C[C@H]3C[C]12)[C@@H]([NH](C)C)C(=O)[C](C(N)=O)C4=O |
| SMILES | C[NH]([C@H]1[C](=O)[C]([C](=O)[C@]2([C@@H]1C[C@H]1C[C]3[C]([CH][CH][C]([C]3[C]([O])C1=C2O)O)N(C)C)O)C(=O)N)C |
| Gibbs energy | -1573.56975 |
| Thermal correction to Energy | 0.558301 |
| Thermal correction to Enthalpy | 0.559245 |
| Thermal correction to Gibbs energy | 0.47182 |