| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C[NH+](C)[C@H]1[C@@H]2C[C@@H]3Cc4c(ccc(c4C(=C3C(=O)[C@]2(C(=C(C1=O)C(=O)N)O)O)O)O)N(C)C |
| Molar mass | 458.19273 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.15711 |
| Number of basis functions | 551 |
| Zero Point Vibrational Energy | 0.542686 |
| InChI | InChI=1/C23H28N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,26-28,31,33H,7-8H2,1-4H3,(H2,24,32)/t9-,11-,17-,23+/m0/s1/f/h24H2 |
| Number of occupied orbitals | 121 |
| Energy at 0K | -1573.892879 |
| Input SMILES | C[NH+]([C@@H]1C(=O)C(=C([C@]2([C@H]1C[C@@H]1Cc3c(C(=C1C2=O)O)c(O)ccc3N(C)C)O)O)C(=O)N)C |
| Number of orbitals | 551 |
| Number of virtual orbitals | 430 |
| Standard InChI | InChI=1S/C23H28N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,26-28,31,33H,7-8H2,1-4H3,(H2,24,32)/t9-,11-,17-,23+/m0/s1 |
| Total Energy | -1573.864189 |
| Entropy | 2.968808D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1573.863245 |
| Standard InChI Key | InChIKey=MDIZRHCLGQFGNS-XDZLDNBXSA-N |
| Final Isomeric SMILES | CN(C)[C]1[CH][CH][C](O)[C]2[C]1C[C@H]3C[C@H]4[C@H]([NH](C)C)C(=O)[C]([C](N)[O])[C](O)[C@]4(O)C(=O)C3=C2O |
| SMILES | C[NH]([C@@H]1[C](=O)[C]([C]([OH])[C@]2([C@H]1C[C@@H]1C[C]3[C]([C]([CH][CH][C]3N(C)C)O)C(=C1C2=O)O)O)[C]([O])[NH2])C |
| Gibbs energy | -1573.95176 |
| Thermal correction to Energy | 0.571376 |
| Thermal correction to Enthalpy | 0.572321 |
| Thermal correction to Gibbs energy | 0.483805 |