| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C([C@@H]1[C@H]([C@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@H]([C@](O2)(CO)O)O)O)O)O)O)O |
| Molar mass | 342.11621 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 16.31282 |
| Number of basis functions | 389 |
| Zero Point Vibrational Energy | 0.403805 |
| InChI | InChI=1/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8-,9-,10-,11+,12-/m1/s1 |
| Number of occupied orbitals | 91 |
| Energy at 0K | -1290.242834 |
| Input SMILES | OC[C@H]1O[C@H](OC[C@H]2O[C@]([C@@H]([C@@H]2O)O)(O)CO)[C@@H]([C@@H]([C@@H]1O)O)O |
| Number of orbitals | 389 |
| Number of virtual orbitals | 298 |
| Standard InChI | InChI=1S/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8-,9-,10-,11+,12-/m1/s1 |
| Total Energy | -1290.220814 |
| Entropy | 2.464934D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1290.21987 |
| Standard InChI Key | InChIKey=PVXPPJIGRGXGCY-GFKYMIRASA-N |
| Final Isomeric SMILES | OC[C@H]1O[C@H](OC[C@H]2O[C@](O)(CO)[C@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@@H]1O |
| SMILES | OC[C@H]1O[C@H](OC[C@H]2O[C@]([C@@H]([C@@H]2O)O)(O)CO)[C@@H]([C@@H]([C@@H]1O)O)O |
| Gibbs energy | -1290.293362 |
| Thermal correction to Energy | 0.425825 |
| Thermal correction to Enthalpy | 0.426769 |
| Thermal correction to Gibbs energy | 0.353277 |