| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | C1C[C@@H]2C=C[C@H]1[C@H]([C@H]2C(=O)[O-])C(=O)[O-] |
| Molar mass | 194.05791 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 13.34789 |
| Number of basis functions | 230 |
| Zero Point Vibrational Energy | 0.200378 |
| InChI | InChI=1/C10H10O4/c11-9(12)7-5-1-2-6(4-3-5)8(7)10(13)14/h1-2,5-8H,3-4H2/t5-,6+,7-,8+ |
| Number of occupied orbitals | 52 |
| Energy at 0K | -683.658983 |
| Input SMILES | [O-]C(=O)[C@@H]1[C@H]2CC[C@@H]([C@@H]1C(=O)[O-])C=C2 |
| Number of orbitals | 230 |
| Number of virtual orbitals | 178 |
| Standard InChI | InChI=1S/C10H10O4/c11-9(12)7-5-1-2-6(4-3-5)8(7)10(13)14/h1-2,5-8H,3-4H2/t5-,6+,7-,8+ |
| Total Energy | -683.648245 |
| Entropy | 1.659064D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -683.647301 |
| Standard InChI Key | InChIKey=IWKBPXIJSYZZED-KVFPUHGPSA-N |
| Final Isomeric SMILES | [O][C]([O])[C@@H]1[C@H]2CC[C@H](C=C2)[C@@H]1[C]([O])[O] |
| SMILES | [O][C]([O])[C@@H]1[C@H]2CC[C@@H]([C@@H]1[C]([O])[O])C=C2 |
| Gibbs energy | -683.696766 |
| Thermal correction to Energy | 0.211116 |
| Thermal correction to Enthalpy | 0.21206 |
| Thermal correction to Gibbs energy | 0.162595 |