| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC[C@H](C)[C@@H](C(=O)O[C@@H]([C@@H](C)CC)C(=O)O[C@@H]([C@@H](C)CC)C(=O)OC[C@@H]([C@@H]([C@@H]([C@@H](CO)O)O)O)O)O |
| Molar mass | 524.28328 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 16.28942 |
| Number of basis functions | 628 |
| Zero Point Vibrational Energy | 0.742466 |
| InChI | InChI=1/C24H44O12/c1-7-12(4)17(28)22(31)35-21(14(6)9-3)24(33)36-20(13(5)8-2)23(32)34-11-16(27)19(30)18(29)15(26)10-25/h12-21,25-30H,7-11H2,1-6H3/t12-,13-,14-,15+,16-,17-,18+,19-,20-,21-/m0/s1 |
| Number of occupied orbitals | 142 |
| Energy at 0K | -1832.08132 |
| Input SMILES | CC[C@@H]([C@@H](C(=O)OC[C@@H]([C@@H]([C@@H]([C@@H](CO)O)O)O)O)OC(=O)[C@H]([C@H](CC)C)OC(=O)[C@H]([C@H](CC)C)O)C |
| Number of orbitals | 628 |
| Number of virtual orbitals | 486 |
| Standard InChI | InChI=1S/C24H44O12/c1-7-12(4)17(28)22(31)35-21(14(6)9-3)24(33)36-20(13(5)8-2)23(32)34-11-16(27)19(30)18(29)15(26)10-25/h12-21,25-30H,7-11H2,1-6H3/t12-,13-,14-,15+,16-,17-,18+,19-,20-,21-/m0/s1 |
| Total Energy | -1832.040344 |
| Entropy | 4.080932D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1832.0394 |
| Standard InChI Key | InChIKey=UCAFTLMODRRASO-DTRVYOHYSA-N |
| Final Isomeric SMILES | CC[C@H](C)[C@H](O)C(=O)O[C@@H]([C@@H](C)CC)C(=O)O[C@@H]([C@@H](C)CC)C(=O)OC[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| SMILES | CC[C@@H]([C@@H](C(=O)OC[C@@H]([C@@H]([C@@H]([C@@H](CO)O)O)O)O)OC(=O)[C@H]([C@H](CC)C)OC(=O)[C@H]([C@H](CC)C)O)C |
| Gibbs energy | -1832.161073 |
| Thermal correction to Energy | 0.783442 |
| Thermal correction to Enthalpy | 0.784386 |
| Thermal correction to Gibbs energy | 0.662713 |