| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC[C@H](C)N1C(=O)[C@@H]2[C@H](N[C@@]3([C@@H]2C1=O)c4cccc(c4NC3=O)Cl)CCC(=O)[O-] |
| Molar mass | 418.11697 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.47874 |
| Number of basis functions | 481 |
| Zero Point Vibrational Energy | 0.424037 |
| InChI | InChI=1/C20H21ClN3O5/c1-3-9(2)24-17(27)14-12(7-8-13(25)26)23-20(15(14)18(24)28)10-5-4-6-11(21)16(10)22-19(20)29/h4-6,9,12,14-15,23H,3,7-8H2,1-2H3,(H,22,29)/t9-,12+,14+,15-,20+/m0/s1/f/h22H |
| Number of occupied orbitals | 110 |
| Energy at 0K | -1766.407184 |
| Input SMILES | CC[C@@H](N1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(N[C@@H]2CCC(=O)[O-])C(=O)Nc2c1cccc2Cl)C |
| Number of orbitals | 481 |
| Number of virtual orbitals | 371 |
| Standard InChI | InChI=1S/C20H21ClN3O5/c1-3-9(2)24-17(27)14-12(7-8-13(25)26)23-20(15(14)18(24)28)10-5-4-6-11(21)16(10)22-19(20)29/h4-6,9,12,14-15,23H,3,7-8H2,1-2H3,(H,22,29)/t9-,12+,14+,15-,20+/m0/s1 |
| Total Energy | -1766.381935 |
| Entropy | 2.868455D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1766.380991 |
| Standard InChI Key | InChIKey=GOIOTPKMVAJAAC-ZNBYNWONSA-N |
| Final Isomeric SMILES | CC[C@H](C)N1C(=O)[C@@H]2[C@@H](CCC([O])=O)N[C@]3([C]4[CH][CH][CH][C](Cl)[C]4NC3=O)[C@@H]2C1=O |
| SMILES | CC[C@@H](N1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(N[C@@H]2CC[C]([O])=O)C(=O)N[C]2[C]1[CH][CH][CH][C]2Cl)C |
| Gibbs energy | -1766.466514 |
| Thermal correction to Energy | 0.449286 |
| Thermal correction to Enthalpy | 0.45023 |
| Thermal correction to Gibbs energy | 0.364707 |