| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=C)[C@H]1CC[C@]2([C@@]1(N(C(=O)O2)CCC(=O)N)C)C |
| Molar mass | 266.16304 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 14.24396 |
| Number of basis functions | 329 |
| Zero Point Vibrational Energy | 0.379409 |
| InChI | InChI=1/C14H22N2O3/c1-9(2)10-5-7-13(3)14(10,4)16(12(18)19-13)8-6-11(15)17/h10H,1,5-8H2,2-4H3,(H2,15,17)/t10-,13+,14-/m1/s1/f/h15H2 |
| Number of occupied orbitals | 72 |
| Energy at 0K | -876.108101 |
| Input SMILES | NC(=O)CCN1C(=O)O[C@@]2([C@@]1(C)[C@H](CC2)C(=C)C)C |
| Number of orbitals | 329 |
| Number of virtual orbitals | 257 |
| Standard InChI | InChI=1S/C14H22N2O3/c1-9(2)10-5-7-13(3)14(10,4)16(12(18)19-13)8-6-11(15)17/h10H,1,5-8H2,2-4H3,(H2,15,17)/t10-,13+,14-/m1/s1 |
| Total Energy | -876.0895 |
| Entropy | 2.274560D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -876.088556 |
| Standard InChI Key | InChIKey=CBQJCJATQXXLHT-DDTOSNHZSA-N |
| Final Isomeric SMILES | CC(=C)[C@H]1CC[C@]2(C)OC(=O)N(CCC(N)=O)[C@]12C |
| SMILES | NC(=O)CCN1C(=O)O[C@@]2([C@@]1(C)[C@H](CC2)C(=C)C)C |
| Gibbs energy | -876.156372 |
| Thermal correction to Energy | 0.39801 |
| Thermal correction to Enthalpy | 0.398954 |
| Thermal correction to Gibbs energy | 0.331137 |