| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=C)[C@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)[O-] |
| Molar mass | 455.35252 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.90571 |
| Number of basis functions | 589 |
| Zero Point Vibrational Energy | 0.779509 |
| InChI | InChI=1/C30H47O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3/t19-,20-,21+,22-,23+,24-,27+,28-,29-,30+/m1/s1 |
| Number of occupied orbitals | 126 |
| Energy at 0K | -1387.203275 |
| Input SMILES | CC(=C)[C@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)C(=O)[O-] |
| Number of orbitals | 589 |
| Number of virtual orbitals | 463 |
| Standard InChI | InChI=1S/C30H47O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3/t19-,20-,21+,22-,23+,24-,27+,28-,29-,30+/m1/s1 |
| Total Energy | -1387.173531 |
| Entropy | 2.903102D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1387.172587 |
| Standard InChI Key | InChIKey=VAJAWIQYQMTUBA-SILQXMKOSA-N |
| Final Isomeric SMILES | CC(=C)[C@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]12)[C]([O])[O] |
| SMILES | CC(=C)[C@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)[C]([O])[O] |
| Gibbs energy | -1387.259143 |
| Thermal correction to Energy | 0.809253 |
| Thermal correction to Enthalpy | 0.810197 |
| Thermal correction to Gibbs energy | 0.723641 |