| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=CCSC1=N[C@@H]2CS(=O)(=O)C[C@@H]2N1c3cccc(c3)Cl)C |
| Molar mass | 370.05765 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.15768 |
| Number of basis functions | 395 |
| Zero Point Vibrational Energy | 0.355963 |
| InChI | InChI=1/C16H19ClN2O2S2/c1-11(2)6-7-22-16-18-14-9-23(20,21)10-15(14)19(16)13-5-3-4-12(17)8-13/h3-6,8,14-15H,7,9-10H2,1-2H3/t14-,15+/m1/s1 |
| Number of occupied orbitals | 97 |
| Energy at 0K | -2129.631242 |
| Input SMILES | CC(=CCSC1=N[C@H]2[C@@H](N1c1cccc(c1)Cl)CS(=O)(=O)C2)C |
| Number of orbitals | 395 |
| Number of virtual orbitals | 298 |
| Standard InChI | InChI=1S/C16H19ClN2O2S2/c1-11(2)6-7-22-16-18-14-9-23(20,21)10-15(14)19(16)13-5-3-4-12(17)8-13/h3-6,8,14-15H,7,9-10H2,1-2H3/t14-,15+/m1/s1 |
| Total Energy | -2129.609925 |
| Entropy | 2.581855D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2129.608981 |
| Standard InChI Key | InChIKey=WGBTYTHRMATWSM-CABCVRRESA-N |
| Final Isomeric SMILES | CC(C)=CCSC1=N[C@@H]2C[S]([O])(=O)C[C@@H]2N1[C]3[CH][CH][CH][C](Cl)[CH]3 |
| SMILES | CC(=CCSC1=N[C@H]2[C@@H](N1[C]1[CH][CH][CH][C]([CH]1)Cl)C[S@@](=O)([O])C2)C |
| Gibbs energy | -2129.685959 |
| Thermal correction to Energy | 0.377279 |
| Thermal correction to Enthalpy | 0.378224 |
| Thermal correction to Gibbs energy | 0.301246 |