| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=O)/C(=N/Nc1ccccc1)/[C@@H]([C@H]2C(=O)[NH+]=c3ccccc3=[NH+]2)C(=O)c4ccccc4 |
| Molar mass | 426.16919 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 4.29882 |
| Number of basis functions | 524 |
| Zero Point Vibrational Energy | 0.461941 |
| InChI | InChI=1/C25H22N4O3/c1-16(30)22(29-28-18-12-6-3-7-13-18)21(24(31)17-10-4-2-5-11-17)23-25(32)27-20-15-9-8-14-19(20)26-23/h2-15,21,23,26,28H,1H3,(H,27,32)/t21-,23-/m0/s1/f/h27H |
| Number of occupied orbitals | 111 |
| Energy at 0K | -1400.820565 |
| Input SMILES | CC(=O)/C(=N/Nc1ccccc1)/[C@@H]([C@@H]1[NH+]=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 |
| Number of orbitals | 524 |
| Number of virtual orbitals | 413 |
| Standard InChI | InChI=1S/C25H22N4O3/c1-16(30)22(29-28-18-12-6-3-7-13-18)21(24(31)17-10-4-2-5-11-17)23-25(32)27-20-15-9-8-14-19(20)26-23/h2-15,21,23,26,28H,1H3,(H,27,32)/t21-,23-/m0/s1 |
| Total Energy | -1400.794932 |
| Entropy | 2.846051D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1400.793988 |
| Standard InChI Key | InChIKey=DHTCYKQZYYENGC-GMAHTHKFSA-N |
| Final Isomeric SMILES | CC(=O)[C]([N]N[C]1[CH][CH][CH][CH][CH]1)[C@H]([C]([O])[C]2[CH][CH][CH][CH][CH]2)[C@@H]3N[C]4C=CC=C[C]4NC3=O |
| SMILES | O=C1[NH][C]2[CH]=CC=[CH][C]2[NH][C@H]1[C@@H]([C]([O])[C]1[CH][CH][CH][CH][CH]1)[C]([N][NH][C]1[CH][CH][CH][CH][CH]1)C(=O)C |
| Gibbs energy | -1400.878843 |
| Thermal correction to Energy | 0.487573 |
| Thermal correction to Enthalpy | 0.488518 |
| Thermal correction to Gibbs energy | 0.403663 |