| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=O)[C@H]1CC[C@H]([C@H](C1)[N+](=O)[O-])[NH2+]C2CCC(CC2)[N+](=O)[O-] |
| Molar mass | 314.1716 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 13.49374 |
| Number of basis functions | 378 |
| Zero Point Vibrational Energy | 0.428944 |
| InChI | InChI=1/C14H24N3O5/c1-9(18)10-2-7-13(14(8-10)17(21)22)15-11-3-5-12(6-4-11)16(19)20/h10-14H,2-8,15H2,1H3/t10-,11-,12-,13+,14-/m0/s1 |
| Number of occupied orbitals | 84 |
| Energy at 0K | -1080.931139 |
| Input SMILES | CC(=O)[C@H]1CC[C@H]([C@H](C1)[N+](=O)[O-])[NH2+]C1CCC(CC1)[N+](=O)[O-] |
| Number of orbitals | 378 |
| Number of virtual orbitals | 294 |
| Standard InChI | InChI=1S/C14H24N3O5/c1-9(18)10-2-7-13(14(8-10)17(21)22)15-11-3-5-12(6-4-11)16(19)20/h10-14H,2-8,15H2,1H3/t10-,11-,12-,13+,14-/m0/s1 |
| Total Energy | -1080.910917 |
| Entropy | 2.490927D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1080.909972 |
| Standard InChI Key | InChIKey=LAAXLVBLCLYAMZ-YHQUGGNUSA-N |
| Final Isomeric SMILES | CC(=O)[C@H]1CC[C@@H]([NH2][C@@H]2CC[C@H](CC2)N([O])[O])[C@H](C1)N([O])[O] |
| SMILES | CC(=O)[C@H]1CC[C@H]([C@H](C1)[N]([O])[O])[NH2][C@@H]1CC[C@H](CC1)[N]([O])[O] |
| Gibbs energy | -1080.984239 |
| Thermal correction to Energy | 0.449167 |
| Thermal correction to Enthalpy | 0.450111 |
| Thermal correction to Gibbs energy | 0.375844 |