| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=O)c1c(cccc1O[C@@H]2[C@H]([C@H]([C@@H]([C@@H](O2)CO)O)O)O)O |
| Molar mass | 314.10017 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.95086 |
| Number of basis functions | 366 |
| Zero Point Vibrational Energy | 0.346979 |
| InChI | InChI=1/C14H18O8/c1-6(16)10-7(17)3-2-4-8(10)21-14-13(20)12(19)11(18)9(5-15)22-14/h2-4,9,11-15,17-20H,5H2,1H3/t9-,11+,12-,13-,14-/m0/s1 |
| Number of occupied orbitals | 83 |
| Energy at 0K | -1139.152481 |
| Input SMILES | OC[C@@H]1O[C@H](Oc2cccc(c2C(=O)C)O)[C@H]([C@H]([C@@H]1O)O)O |
| Number of orbitals | 366 |
| Number of virtual orbitals | 283 |
| Standard InChI | InChI=1S/C14H18O8/c1-6(16)10-7(17)3-2-4-8(10)21-14-13(20)12(19)11(18)9(5-15)22-14/h2-4,9,11-15,17-20H,5H2,1H3/t9-,11+,12-,13-,14-/m0/s1 |
| Total Energy | -1139.132464 |
| Entropy | 2.349790D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1139.13152 |
| Standard InChI Key | InChIKey=VXNVOYRAYBBNPE-SWTDPAGASA-N |
| Final Isomeric SMILES | CC(=O)[C]1[C](O)[CH][CH][CH][C]1O[C@H]2O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]2O |
| SMILES | OC[C@@H]1O[C@H](O[C]2[CH][CH][CH][C]([C]2C(=O)C)O)[C@H]([C@H]([C@@H]1O)O)O |
| Gibbs energy | -1139.201579 |
| Thermal correction to Energy | 0.366995 |
| Thermal correction to Enthalpy | 0.367939 |
| Thermal correction to Gibbs energy | 0.29788 |