| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C=C)C(=C)C1CC(C)C=C1 |
| Molar mass | 162.14085 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 13.57293 |
| Number of basis functions | 216 |
| Zero Point Vibrational Energy | 0.287567 |
| InChI | InChI=1/C12H24/c1-5-10(3)11(4)12-7-6-9(2)8-12/h9-12H,5-8H2,1-4H3/t9-,10-,11-,12+/m0/s1 |
| Number of occupied orbitals | 45 |
| Energy at 0K | -464.546959 |
| Input SMILES | CC(C=C)C(=C)C1CC(C)C=C1 |
| Number of orbitals | 216 |
| Number of virtual orbitals | 171 |
| Standard InChI | InChI=1S/C12H24/c1-5-10(3)11(4)12-7-6-9(2)8-12/h9-12H,5-8H2,1-4H3/t9-,10-,11-,12+/m0/s1 |
| Total Energy | -464.534584 |
| Entropy | 1.767801D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -464.53364 |
| Standard InChI Key | InChIKey=OQTFFEYUMLLISS-FIQHERPVSA-N |
| Final Isomeric SMILES | CC[C@H](C)[C@H](C)[C@@H]1CC[C@H](C)C1 |
| SMILES | CC[C@@H]([C@@H]([C@@H]1CC[C@@H](C1)C)C)C |
| Gibbs energy | -464.586347 |
| Thermal correction to Energy | 0.299943 |
| Thermal correction to Enthalpy | 0.300887 |
| Thermal correction to Gibbs energy | 0.24818 |
