| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)C[C@@H](C(=O)NC1CCCC1)N2C(=O)[C@@]3([C@H]4C(=c5ccccc5=[NH+]4)CCN3C2=O)C |
| Molar mass | 437.25527 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.12744 |
| Number of basis functions | 546 |
| Zero Point Vibrational Energy | 0.599974 |
| InChI | InChI=1/C25H33N4O3/c1-15(2)14-20(22(30)26-16-8-4-5-9-16)29-23(31)25(3)21-18(12-13-28(25)24(29)32)17-10-6-7-11-19(17)27-21/h6-7,10-11,15-16,20-21,27H,4-5,8-9,12-14H2,1-3H3,(H,26,30)/t20-,21+,25-/m0/s1/f/h26H |
| Number of occupied orbitals | 117 |
| Energy at 0K | -1407.585147 |
| Input SMILES | CC(C[C@H](N1C(=O)N2[C@@](C1=O)(C)[C@@H]1[NH+]=c3c(=C1CC2)cccc3)C(=O)NC1CCCC1)C |
| Number of orbitals | 546 |
| Number of virtual orbitals | 429 |
| Standard InChI | InChI=1S/C25H33N4O3/c1-15(2)14-20(22(30)26-16-8-4-5-9-16)29-23(31)25(3)21-18(12-13-28(25)24(29)32)17-10-6-7-11-19(17)27-21/h6-7,10-11,15-16,20-21,27H,4-5,8-9,12-14H2,1-3H3,(H,26,30)/t20-,21+,25-/m0/s1 |
| Total Energy | -1407.55672 |
| Entropy | 3.095623D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1407.555776 |
| Standard InChI Key | InChIKey=SPKDJNFKPFGVDN-BKSPAHHJSA-N |
| Final Isomeric SMILES | CC(C)C[C@H](N1C(=O)N2CCC3=C4C=CC=C[C]4N[C@H]3[C@@]2(C)C1=O)C(=O)NC5CCCC5 |
| SMILES | CC(C[C@H](N1C(=O)N2[C@@](C1=O)(C)[C@@H]1[NH][C]3[C](=C1CC2)[CH]=[CH][CH]=[CH]3)[C]([NH]C1CCCC1)=O)C |
| Gibbs energy | -1407.648072 |
| Thermal correction to Energy | 0.6284 |
| Thermal correction to Enthalpy | 0.629345 |
| Thermal correction to Gibbs energy | 0.537049 |