| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)CSc1ccc(cc1[N+](=O)[O-])C(=O)N2[C@H]3CCCC[C@H]3C[C@H]2C(=O)[O-] |
| Molar mass | 405.14842 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.045 |
| Number of basis functions | 474 |
| Zero Point Vibrational Energy | 0.467307 |
| InChI | InChI=1/C20H25N2O5S/c1-12(2)11-28-18-8-7-14(10-16(18)22(26)27)19(23)21-15-6-4-3-5-13(15)9-17(21)20(24)25/h7-8,10,12-13,15,17H,3-6,9,11H2,1-2H3/t13-,15-,17-/m0/s1 |
| Number of occupied orbitals | 108 |
| Energy at 0K | -1652.134327 |
| Input SMILES | CC(CSc1ccc(cc1[N+](=O)[O-])C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)[O-])C |
| Number of orbitals | 474 |
| Number of virtual orbitals | 366 |
| Standard InChI | InChI=1S/C20H25N2O5S/c1-12(2)11-28-18-8-7-14(10-16(18)22(26)27)19(23)21-15-6-4-3-5-13(15)9-17(21)20(24)25/h7-8,10,12-13,15,17H,3-6,9,11H2,1-2H3/t13-,15-,17-/m0/s1 |
| Total Energy | -1652.109437 |
| Entropy | 2.804595D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1652.108493 |
| Standard InChI Key | InChIKey=LECSWLDKYHHDRW-QRTARXTBSA-N |
| Final Isomeric SMILES | CC(C)CS[C]1[CH][CH][C]([CH][C]1N([O])[O])C(=O)N2[C@@H](C[C@@H]3CCCC[C@H]23)[C]([O])[O] |
| SMILES | CC(CS[C]1[CH][CH][C]([CH][C]1[N]([O])[O])[C]([N]1[C@H]2CCCC[C@H]2C[C@H]1[C]([O])[O])=O)C |
| Gibbs energy | -1652.192112 |
| Thermal correction to Energy | 0.492197 |
| Thermal correction to Enthalpy | 0.493141 |
| Thermal correction to Gibbs energy | 0.409522 |