| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)NC(=O)O[C@@H]1CC[C@@]2([C@@H]([C@]1(C)CO)CC[C@H]([C@H]2CC(=O)NCc3cccs3)O)C |
| Molar mass | 466.25014 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.37183 |
| Number of basis functions | 560 |
| Zero Point Vibrational Energy | 0.653781 |
| InChI | InChI=1/C24H38N2O5S/c1-15(2)26-22(30)31-20-9-10-23(3)17(12-21(29)25-13-16-6-5-11-32-16)18(28)7-8-19(23)24(20,4)14-27/h5-6,11,15,17-20,27-28H,7-10,12-14H2,1-4H3,(H,25,29)(H,26,30)/t17-,18-,19+,20-,23+,24+/m1/s1/f/h25-26H |
| Number of occupied orbitals | 126 |
| Energy at 0K | -1811.052681 |
| Input SMILES | OC[C@]1(C)[C@@H](CC[C@@]2([C@@H]1CC[C@H]([C@H]2CC(=O)NCc1cccs1)O)C)OC(=O)NC(C)C |
| Number of orbitals | 560 |
| Number of virtual orbitals | 434 |
| Standard InChI | InChI=1S/C24H38N2O5S/c1-15(2)26-22(30)31-20-9-10-23(3)17(12-21(29)25-13-16-6-5-11-32-16)18(28)7-8-19(23)24(20,4)14-27/h5-6,11,15,17-20,27-28H,7-10,12-14H2,1-4H3,(H,25,29)(H,26,30)/t17-,18-,19+,20-,23+,24+/m1/s1 |
| Total Energy | -1811.020805 |
| Entropy | 3.340332D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1811.019861 |
| Standard InChI Key | InChIKey=KKDKJQYAUGRYHR-PRIYMHJNSA-N |
| Final Isomeric SMILES | CC(C)NC(=O)O[C@@H]1CC[C@@]2(C)[C@H](CC(=O)NCc3sccc3)[C@H](O)CC[C@@H]2[C@]1(C)CO |
| SMILES | OC[C@]1(C)[C@@H](CC[C@@]2([C@@H]1CC[C@H]([C@H]2CC(=O)NCC1=[CH][CH]=CS1)O)C)OC(=O)NC(C)C |
| Gibbs energy | -1811.119453 |
| Thermal correction to Energy | 0.685658 |
| Thermal correction to Enthalpy | 0.686602 |
| Thermal correction to Gibbs energy | 0.58701 |