| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)c1ccc(cc1)[C@H]2C/C(=C/3\C(=O)NC(=O)N(C3=O)c4ccc(cc4)Cl)/NN2C(=O)C |
| Molar mass | 466.14078 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.31984 |
| Number of basis functions | 545 |
| Zero Point Vibrational Energy | 0.473688 |
| InChI | InChI=1/C24H23ClN4O4/c1-13(2)15-4-6-16(7-5-15)20-12-19(27-29(20)14(3)30)21-22(31)26-24(33)28(23(21)32)18-10-8-17(25)9-11-18/h4-11,13,20,27H,12H2,1-3H3,(H,26,31,33)/t20-/m1/s1/f/h26H |
| Number of occupied orbitals | 122 |
| Energy at 0K | -1898.559103 |
| Input SMILES | Clc1ccc(cc1)N1C(=O)NC(=O)/C(=C/2\C[C@@H](N(N2)C(=O)C)c2ccc(cc2)C(C)C)/C1=O |
| Number of orbitals | 545 |
| Number of virtual orbitals | 423 |
| Standard InChI | InChI=1S/C24H23ClN4O4/c1-13(2)15-4-6-16(7-5-15)20-12-19(27-29(20)14(3)30)21-22(31)26-24(33)28(23(21)32)18-10-8-17(25)9-11-18/h4-11,13,20,27H,12H2,1-3H3,(H,26,31,33)/t20-/m1/s1 |
| Total Energy | -1898.530919 |
| Entropy | 3.126950D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1898.529975 |
| Standard InChI Key | InChIKey=AYWHQYQOCCVVCX-HXUWFJFHSA-N |
| Final Isomeric SMILES | CC(C)[C]1[CH][CH][C]([CH][CH]1)[C@H]2C[C](NN2C(C)=O)[C]3C(=O)NC(=O)N([C]4[CH][CH][C](Cl)[CH][CH]4)C3=O |
| SMILES | Cl[C]1[CH][CH][C]([CH][CH]1)N1C(=O)NC(=O)[C]([C]2[NH]N([C@H](C2)[C]2[CH][CH][C]([CH][CH]2)C(C)C)C(=O)C)C1=O |
| Gibbs energy | -1898.623205 |
| Thermal correction to Energy | 0.501871 |
| Thermal correction to Enthalpy | 0.502815 |
| Thermal correction to Gibbs energy | 0.409585 |