| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)c1ccc(cc1)NC(=O)CN(c2ccccc2)S(=O)(=O)C |
| Molar mass | 346.13511 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.76611 |
| Number of basis functions | 408 |
| Zero Point Vibrational Energy | 0.405271 |
| InChI | InChI=1/C18H22N2O3S/c1-14(2)15-9-11-16(12-10-15)19-18(21)13-20(24(3,22)23)17-7-5-4-6-8-17/h4-12,14H,13H2,1-3H3,(H,19,21)/f/h19H |
| Number of occupied orbitals | 92 |
| Energy at 0K | -1424.983534 |
| Input SMILES | CC(c1ccc(cc1)NC(=O)CN(S(=O)(=O)C)c1ccccc1)C |
| Number of orbitals | 408 |
| Number of virtual orbitals | 316 |
| Standard InChI | InChI=1S/C18H22N2O3S/c1-14(2)15-9-11-16(12-10-15)19-18(21)13-20(24(3,22)23)17-7-5-4-6-8-17/h4-12,14H,13H2,1-3H3,(H,19,21) |
| Total Energy | -1424.961455 |
| Entropy | 2.634010D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1424.960511 |
| Standard InChI Key | InChIKey=FSQUJVZICDTZQZ-UHFFFAOYSA-N |
| Final Isomeric SMILES | CC(C)[C]1[CH][CH][C]([CH][CH]1)NC(=O)CN([C]2[CH][CH][CH][CH][CH]2)[S](C)([O])=O |
| SMILES | CC([C]1[CH][CH][C]([CH][CH]1)NC(=O)CN([S@]([O])(=O)C)[C]1[CH][CH][CH][CH][CH]1)C |
| Gibbs energy | -1425.039044 |
| Thermal correction to Energy | 0.42735 |
| Thermal correction to Enthalpy | 0.428294 |
| Thermal correction to Gibbs energy | 0.349761 |