| Temperature | 298.15 | 
| Wave Function / DFT | RHF | 
| SMILES | CC1(CCC2C(CC#N)C12)C#C | 
| Molar mass | 159.1048 | 
| Pressure | 1 | 
| Basis set | 6-31G(d) | 
| HOMO-LUMO gap | 15.72697 | 
| Number of basis functions | 206 | 
| Zero Point Vibrational Energy | 0.227415 | 
| InChI | InChI=1/C11H21N/c1-3-11(2)6-4-8-9(5-7-12)10(8)11/h8-10H,3-7,12H2,1-2H3/t8-,9+,10-,11+/m0/s1 | 
| Number of occupied orbitals | 43 | 
| Energy at 0K | -478.239156 | 
| Input SMILES | CC1(CCC2C(CC#N)C12)C#C | 
| Number of orbitals | 206 | 
| Number of virtual orbitals | 163 | 
| Standard InChI | InChI=1S/C11H21N/c1-3-11(2)6-4-8-9(5-7-12)10(8)11/h8-10H,3-7,12H2,1-2H3/t8-,9+,10-,11+/m0/s1 | 
| Total Energy | -478.228311 | 
| Entropy | 1.626966D-04 | 
| Number of imaginary frequencies | 0 | 
| Enthalpy | -478.227367 | 
| Standard InChI Key | InChIKey=RYBBYBPDUNRSQQ-ZRUFSTJUSA-N | 
| Final Isomeric SMILES | CC[C@]1(C)CC[C@H]2[C@@H](CCN)[C@@H]12 | 
| SMILES | NCC[C@@H]1[C@H]2[C@@H]1[C@](CC2)(C)CC | 
| Gibbs energy | -478.275875 | 
| Thermal correction to Energy | 0.238259 | 
| Thermal correction to Enthalpy | 0.239203 | 
| Thermal correction to Gibbs energy | 0.190696 |