| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCC[C@@H](C)NC(=O)[C@H]1CCC[NH+](C1)CCC(=O)Nc2cc(ccc2Cl)S(=O)(=O)N(C)C |
| Molar mass | 487.21458 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.94597 |
| Number of basis functions | 560 |
| Zero Point Vibrational Energy | 0.626417 |
| InChI | InChI=1/C22H36ClN4O4S/c1-5-7-16(2)24-22(29)17-8-6-12-27(15-17)13-11-21(28)25-20-14-18(9-10-19(20)23)32(30,31)26(3)4/h9-10,14,16-17,27H,5-8,11-13,15H2,1-4H3,(H,24,29)(H,25,28)/t16-,17+/m1/s1/f/h24-25H |
| Number of occupied orbitals | 130 |
| Energy at 0K | -2227.441282 |
| Input SMILES | CCC[C@H](NC(=O)[C@H]1CCC[NH+](C1)CCC(=O)Nc1cc(ccc1Cl)S(=O)(=O)N(C)C)C |
| Number of orbitals | 560 |
| Number of virtual orbitals | 430 |
| Standard InChI | InChI=1S/C22H36ClN4O4S/c1-5-7-16(2)24-22(29)17-8-6-12-27(15-17)13-11-21(28)25-20-14-18(9-10-19(20)23)32(30,31)26(3)4/h9-10,14,16-17,27H,5-8,11-13,15H2,1-4H3,(H,24,29)(H,25,28)/t16-,17+/m1/s1 |
| Total Energy | -2227.408192 |
| Entropy | 3.567634D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2227.407248 |
| Standard InChI Key | InChIKey=AATRIWIHPDGWQX-SJORKVTESA-N |
| Final Isomeric SMILES | CCC[C@@H](C)NC(=O)[C@H]1CCC[NH](CCC(=O)N[C]2[CH][C]([CH][CH][C]2Cl)[S](=O)(=O)N(C)C)C1 |
| SMILES | CCC[C@H]([NH][C](=O)[C@H]1CCC[NH](C1)CCC(=O)N[C]1[CH][C]([CH][CH][C]1Cl)S(=O)(=O)N(C)C)C |
| Gibbs energy | -2227.513617 |
| Thermal correction to Energy | 0.659507 |
| Thermal correction to Enthalpy | 0.660451 |
| Thermal correction to Gibbs energy | 0.554082 |