| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCC(C)O[C@H]1C=C(C(O)=O)C[C@H](NC(N)=N)[C@@H]1NC(C)=O |
| Molar mass | 312.17976 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.71496 |
| Number of basis functions | 378 |
| Zero Point Vibrational Energy | 0.421317 |
| InChI | InChI=1/C14H24N4O4/c1-4-7(2)22-11-6-9(13(20)21)5-10(18-14(15)16)12(11)17-8(3)19/h6-7,10-12H,4-5H2,1-3H3,(H,17,19)(H,20,21)(H4,15,16,18)/t7-,10+,11+,12+/m1/s1/f/h15,17-18,20H,16H2 |
| Number of occupied orbitals | 84 |
| Energy at 0K | -1060.983217 |
| Input SMILES | CCC(O[C@H]1C=C(C[C@@H]([C@@H]1NC(=O)C)NC(=N)N)C(=O)O)C |
| Number of orbitals | 378 |
| Number of virtual orbitals | 294 |
| Standard InChI | InChI=1S/C14H24N4O4/c1-4-7(2)22-11-6-9(13(20)21)5-10(18-14(15)16)12(11)17-8(3)19/h6-7,10-12H,4-5H2,1-3H3,(H,17,19)(H,20,21)(H4,15,16,18)/t7-,10+,11+,12+/m1/s1 |
| Total Energy | -1060.960223 |
| Entropy | 2.654302D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1060.959279 |
| Standard InChI Key | InChIKey=BKSBSWKRQZCHQR-VNLLXPHSSA-N |
| Final Isomeric SMILES | CC[C@@H](C)O[C@H]1C=C(C[C@H](NC(N)=N)[C@@H]1NC(C)=O)C(O)=O |
| SMILES | CC[C@H](O[C@H]1C=C(C[C@@H]([C@@H]1NC(=O)C)NC(=N)N)C(=O)O)C |
| Gibbs energy | -1061.038417 |
| Thermal correction to Energy | 0.444311 |
| Thermal correction to Enthalpy | 0.445255 |
| Thermal correction to Gibbs energy | 0.366117 |