| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCCCOc1cccc(c1)N[C@H]2/C(=N/S(=O)(=O)c3ccc(cc3)C)/N=c4ccccc4=[NH+]2 |
| Molar mass | 463.18039 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 6.30564 |
| Number of basis functions | 553 |
| Zero Point Vibrational Energy | 0.52348 |
| InChI | InChI=1/C25H27N4O3S/c1-3-4-16-32-20-9-7-8-19(17-20)26-24-25(28-23-11-6-5-10-22(23)27-24)29-33(30,31)21-14-12-18(2)13-15-21/h5-15,17,24,26-27H,3-4,16H2,1-2H3/t24-/m1/s1 |
| Number of occupied orbitals | 122 |
| Energy at 0K | -1801.462965 |
| Input SMILES | CCCCOc1cccc(c1)N[C@@H]1[NH+]=c2ccccc2=N/C/1=N\S(=O)(=O)c1ccc(cc1)C |
| Number of orbitals | 553 |
| Number of virtual orbitals | 431 |
| Standard InChI | InChI=1S/C25H27N4O3S/c1-3-4-16-32-20-9-7-8-19(17-20)26-24-25(28-23-11-6-5-10-22(23)27-24)29-33(30,31)21-14-12-18(2)13-15-21/h5-15,17,24,26-27H,3-4,16H2,1-2H3/t24-/m1/s1 |
| Total Energy | -1801.433876 |
| Entropy | 3.230220D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1801.432932 |
| Standard InChI Key | InChIKey=HLOTVQLNHQYEBD-XMMPIXPASA-N |
| Final Isomeric SMILES | CCCCO[C]1[CH][CH][CH][C]([CH]1)N[C@@H]2N[C]3C=CC=CC3=NC2=N[S](=O)(=O)[C]4[CH][CH][C](C)[CH][CH]4 |
| SMILES | CCCCO[C]1[CH][CH][CH][C]([CH]1)N[C@@H]1[NH][C]2[CH]=CC=CC2=N/C/1=N\S(=O)(=O)[C]1[CH][CH][C]([CH][CH]1)C |
| Gibbs energy | -1801.529241 |
| Thermal correction to Energy | 0.552568 |
| Thermal correction to Enthalpy | 0.553513 |
| Thermal correction to Gibbs energy | 0.457204 |