| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCCOc1ccc(cc1)[C@H]2[C@H]3[C@@H](C(=O)N(C3=O)CCS(=O)(=O)C)[C@@]([NH2+]2)(CCSC)C(=O)[O-] |
| Molar mass | 498.14945 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.0355 |
| Number of basis functions | 563 |
| Zero Point Vibrational Energy | 0.552773 |
| InChI | InChI=1/C22H30N2O7S2/c1-4-11-31-15-7-5-14(6-8-15)18-16-17(22(23-18,21(27)28)9-12-32-2)20(26)24(19(16)25)10-13-33(3,29)30/h5-8,16-18H,4,9-13,23H2,1-3H3/t16-,17+,18+,22+/m1/s1 |
| Number of occupied orbitals | 132 |
| Energy at 0K | -2277.904593 |
| Input SMILES | CSCC[C@@]1([NH2+][C@H]([C@H]2[C@H]1C(=O)N(C2=O)CCS(=O)(=O)C)c1ccc(cc1)OCCC)C(=O)[O-] |
| Number of orbitals | 563 |
| Number of virtual orbitals | 431 |
| Standard InChI | InChI=1S/C22H30N2O7S2/c1-4-11-31-15-7-5-14(6-8-15)18-16-17(22(23-18,21(27)28)9-12-32-2)20(26)24(19(16)25)10-13-33(3,29)30/h5-8,16-18H,4,9-13,23H2,1-3H3/t16-,17+,18+,22+/m1/s1 |
| Total Energy | -2277.87205 |
| Entropy | 3.499380D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2277.871105 |
| Standard InChI Key | InChIKey=MSTISBSPGSFYFJ-MSQSPTIYSA-N |
| Final Isomeric SMILES | CCCO[C]1[CH][CH][C]([CH][CH]1)[C@@H]2[NH2][C@@](CCSC)([C@H]3[C@H]2C(=O)N(CC[S](C)(=O)=O)C3=O)C([O])=O |
| SMILES | CSCC[C@@]1([NH2][C@H]([C@H]2[C@H]1C(=O)N(C2=O)CCS(=O)(=O)C)[C]1[CH][CH][C]([CH][CH]1)OCCC)[C]([O])=O |
| Gibbs energy | -2277.975439 |
| Thermal correction to Energy | 0.585317 |
| Thermal correction to Enthalpy | 0.586261 |
| Thermal correction to Gibbs energy | 0.481928 |