| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCOC(=O)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)C(=O)N/N=C/[C@@H]3C=c4ccccc4=[NH+]C3=O |
| Molar mass | 469.15457 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 6.85204 |
| Number of basis functions | 549 |
| Zero Point Vibrational Energy | 0.500216 |
| InChI | InChI=1/C23H25N4O5S/c1-2-32-23(31)18-15-8-4-6-10-17(15)33-22(18)26-20(29)21(30)27-24-12-14-11-13-7-3-5-9-16(13)25-19(14)28/h3,5,7,9,11-12,14,17,22H,2,4,6,8,10H2,1H3,(H,25,28)(H,26,29)(H,27,30)/b24-12+/t14-,17-,22-/m0/s1/f/h25-27H |
| Number of occupied orbitals | 123 |
| Energy at 0K | -1874.443994 |
| Input SMILES | CCOC(=O)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)C(=O)N/N=C/[C@@H]1C=c2ccccc2=[NH+]C1=O |
| Number of orbitals | 549 |
| Number of virtual orbitals | 426 |
| Standard InChI | InChI=1S/C23H25N4O5S/c1-2-32-23(31)18-15-8-4-6-10-17(15)33-22(18)26-20(29)21(30)27-24-12-14-11-13-7-3-5-9-16(13)25-19(14)28/h3,5,7,9,11-12,14,17,22H,2,4,6,8,10H2,1H3,(H,25,28)(H,26,29)(H,27,30)/b24-12+/t14-,17-,22-/m0/s1 |
| Total Energy | -1874.414851 |
| Entropy | 3.248432D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1874.413907 |
| Standard InChI Key | InChIKey=TZCPUTFLNSZTMD-JCVMPDPUSA-N |
| Final Isomeric SMILES | CCOC(=O)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)C(=O)N\N=C\[C@@H]3[CH][C]4C=C[CH][CH][C]4NC3=O |
| SMILES | CCOC(=O)C1=C2CCCC[C@@H]2S[C@@H]1[NH][C](=O)C(=O)N/N=C/[C@@H]1[CH][C]2[CH]=[CH][CH][CH][C]2NC1=O |
| Gibbs energy | -1874.510759 |
| Thermal correction to Energy | 0.52936 |
| Thermal correction to Enthalpy | 0.530304 |
| Thermal correction to Gibbs energy | 0.433451 |