| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CCn1c2ccccc2c3c1ccc(c3)[C@H]4[C@@H]5CC=C[C@H]5c6cccc(c6N4)OCC(C)C |
| Molar mass | 436.25146 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.83956 |
| Number of basis functions | 559 |
| Zero Point Vibrational Energy | 0.594293 |
| InChI | InChI=1/C30H32N2O/c1-4-32-26-13-6-5-9-22(26)25-17-20(15-16-27(25)32)29-23-11-7-10-21(23)24-12-8-14-28(30(24)31-29)33-18-19(2)3/h5-10,12-17,19,21,23,29,31H,4,11,18H2,1-3H3/t21-,23-,29+/m1/s1 |
| Number of occupied orbitals | 117 |
| Energy at 0K | -1337.851508 |
| Input SMILES | CCn1c2ccc(cc2c2c1cccc2)[C@@H]1Nc2c(cccc2[C@H]2[C@H]1CC=C2)OCC(C)C |
| Number of orbitals | 559 |
| Number of virtual orbitals | 442 |
| Standard InChI | InChI=1S/C30H32N2O/c1-4-32-26-13-6-5-9-22(26)25-17-20(15-16-27(25)32)29-23-11-7-10-21(23)24-12-8-14-28(30(24)31-29)33-18-19(2)3/h5-10,12-17,19,21,23,29,31H,4,11,18H2,1-3H3/t21-,23-,29+/m1/s1 |
| Total Energy | -1337.824458 |
| Entropy | 2.956331D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1337.823514 |
| Standard InChI Key | InChIKey=VJJMXCXQCUXYRI-NWKHUOOYSA-N |
| Final Isomeric SMILES | CCN1[C]2[CH][CH][CH][CH][C]2[C]3[CH][C]([CH][CH][C]13)[C@@H]4N[C]5[C]([CH][CH][CH][C]5[C@@H]6C=CC[C@@H]46)OCC(C)C |
| SMILES | CCN1[C]2[CH][CH][C]([CH][C]2[C]2[C]1[CH][CH][CH][CH]2)[C@@H]1N[C]2[C]([CH][CH][CH][C]2[C@H]2[C@H]1CC=C2)OCC(C)C |
| Gibbs energy | -1337.911657 |
| Thermal correction to Energy | 0.621343 |
| Thermal correction to Enthalpy | 0.622287 |
| Thermal correction to Gibbs energy | 0.534144 |