| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CN(C)[C@@H]1[C@H]2C[C@@H]3[C@H](c4c(ccc(c4C(=O)C3=C([C@]2(C(=O)/C(=C(/N)\O)/C1=O)O)[O-])O)Cl)O |
| Molar mass | 463.09082 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 9.79275 |
| Number of basis functions | 524 |
| Zero Point Vibrational Energy | 0.428657 |
| InChI | InChI=1/C21H20ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,31-32H,5,23H2,1-2H3/t6-,7+,14+,15+,21+/m0/s1 |
| Number of occupied orbitals | 121 |
| Energy at 0K | -1973.723671 |
| Input SMILES | CN([C@H]1C(=O)/C(=C(/O)\N)/C(=O)[C@]2([C@@H]1C[C@H]1C(=C2[O-])C(=O)c2c([C@@H]1O)c(Cl)ccc2O)O)C |
| Number of orbitals | 524 |
| Number of virtual orbitals | 403 |
| Standard InChI | InChI=1S/C21H20ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,31-32H,5,23H2,1-2H3/t6-,7+,14+,15+,21+/m0/s1 |
| Total Energy | -1973.696974 |
| Entropy | 2.842160D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1973.696029 |
| Standard InChI Key | InChIKey=IJVWZLHIJTUSIG-MRQGMUDQSA-N |
| Final Isomeric SMILES | CN(C)[C@@H]1[C@H]2C[C@H]3[C]([C]([O])[C]4[C](O)[CH][CH][C](Cl)[C]4[C@@H]3O)C(=O)[C@@]2(O)C(=O)[C]([C](N)O)C1=O |
| SMILES | CN([C@H]1C(=O)[C]([C]([NH2])O)C(=O)[C@]2([C@@H]1C[C@H]1[C]([C]2=O)[C]([O])[C]2[C]([C]([CH][CH][C]2O)Cl)[C@@H]1O)O)C |
| Gibbs energy | -1973.780768 |
| Thermal correction to Energy | 0.455354 |
| Thermal correction to Enthalpy | 0.456298 |
| Thermal correction to Gibbs energy | 0.371559 |