| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CN5[C@@H]4CC[C@H]2[C@@H](CC[C@@]3(C)[C@H](O)C(=C/c1ccncc1)/C[C@@H]23)[C@]4(C)C=CC5=O |
| Molar mass | 392.24638 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.49617 |
| Number of basis functions | 499 |
| Zero Point Vibrational Energy | 0.57255 |
| InChI | InChI=1/C25H32N2O2/c1-24-11-7-22(28)27(3)21(24)5-4-18-19(24)6-10-25(2)20(18)15-17(23(25)29)14-16-8-12-26-13-9-16/h7-9,11-14,18-21,23,29H,4-6,10,15H2,1-3H3/b17-14+/t18-,19+,20-,21+,23+,24-,25+/m0/s1 |
| Number of occupied orbitals | 106 |
| Energy at 0K | -1223.378031 |
| Input SMILES | O=C1C=C[C@@]2([C@H](N1C)CC[C@H]1[C@H]2CC[C@@]2([C@H]1C/C(=C\c1ccncc1)/[C@H]2O)C)C |
| Number of orbitals | 499 |
| Number of virtual orbitals | 393 |
| Standard InChI | InChI=1S/C25H32N2O2/c1-24-11-7-22(28)27(3)21(24)5-4-18-19(24)6-10-25(2)20(18)15-17(23(25)29)14-16-8-12-26-13-9-16/h7-9,11-14,18-21,23,29H,4-6,10,15H2,1-3H3/b17-14+/t18-,19+,20-,21+,23+,24-,25+/m0/s1 |
| Total Energy | -1223.354195 |
| Entropy | 2.626966D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1223.353251 |
| Standard InChI Key | InChIKey=SINXEYLFXFHPMM-YGAJUNKASA-N |
| Final Isomeric SMILES | CN1[C@@H]2CC[C@H]3[C@@H](CC[C@@]4(C)[C@H](O)C(/C[C@@H]34)=C/[C]5[CH][CH][N][CH][CH]5)[C@]2(C)C=CC1=O |
| SMILES | O=C1C=C[C@@]2([C@H](N1C)CC[C@H]1[C@H]2CC[C@@]2([C@H]1C/C(=C\[C]1[CH][CH][N][CH][CH]1)/[C@H]2O)C)C |
| Gibbs energy | -1223.431574 |
| Thermal correction to Energy | 0.596386 |
| Thermal correction to Enthalpy | 0.59733 |
| Thermal correction to Gibbs energy | 0.519007 |