| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | Cc1c2ccc(cc2oc(=O)c1CC(=O)N(C)C[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)OCC(=C)C |
| Molar mass | 465.19988 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.4997 |
| Number of basis functions | 557 |
| Zero Point Vibrational Energy | 0.570859 |
| InChI | InChI=1/C23H31NO9/c1-12(2)11-32-14-5-6-15-13(3)16(23(31)33-19(15)7-14)8-20(28)24(4)9-17(26)21(29)22(30)18(27)10-25/h5-7,17-18,21-22,25-27,29-30H,1,8-11H2,2-4H3/t17-,18-,21-,22-/m1/s1 |
| Number of occupied orbitals | 124 |
| Energy at 0K | -1616.623078 |
| Input SMILES | OC[C@H]([C@H]([C@@H]([C@@H](CN(C(=O)Cc1c(=O)oc2c(c1C)ccc(c2)OCC(=C)C)C)O)O)O)O |
| Number of orbitals | 557 |
| Number of virtual orbitals | 433 |
| Standard InChI | InChI=1S/C23H31NO9/c1-12(2)11-32-14-5-6-15-13(3)16(23(31)33-19(15)7-14)8-20(28)24(4)9-17(26)21(29)22(30)18(27)10-25/h5-7,17-18,21-22,25-27,29-30H,1,8-11H2,2-4H3/t17-,18-,21-,22-/m1/s1 |
| Total Energy | -1616.59045 |
| Entropy | 3.435184D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1616.589506 |
| Standard InChI Key | InChIKey=UIJBCIXFSSMAEK-MCEIDBOGSA-N |
| Final Isomeric SMILES | CN(C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)CC1=C(C)[C]2[CH][CH][C]([CH][C]2OC1=O)OCC(C)=C |
| SMILES | OC[C@H]([C@H]([C@@H]([C@@H](C[N]([C](=O)CC1=C(C)[C]2[C]([CH][C]([CH][CH]2)OCC(=C)C)OC1=O)C)O)O)O)O |
| Gibbs energy | -1616.691926 |
| Thermal correction to Energy | 0.603488 |
| Thermal correction to Enthalpy | 0.604432 |
| Thermal correction to Gibbs energy | 0.502012 |