| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | Cc1cc(c(cc1C)N[C@@H]2[C@H]([C@@H]([C@@H](O2)[C@H](CO)O)O)O)N[C@@H]3[C@@H]([C@H]([C@H](O3)[C@@H](CO)O)O)O |
| Molar mass | 460.2057 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.71522 |
| Number of basis functions | 544 |
| Zero Point Vibrational Energy | 0.579933 |
| InChI | InChI=1/C20H32N2O10/c1-7-3-9(21-19-15(29)13(27)17(31-19)11(25)5-23)10(4-8(7)2)22-20-16(30)14(28)18(32-20)12(26)6-24/h3-4,11-30H,5-6H2,1-2H3/t11-,12+,13-,14+,15-,16+,17-,18+,19-,20-/m0/s1 |
| Number of occupied orbitals | 123 |
| Energy at 0K | -1632.862732 |
| Input SMILES | OC[C@H]([C@H]1O[C@@H]([C@@H]([C@H]1O)O)Nc1cc(C)c(cc1N[C@H]1O[C@H]([C@H]([C@@H]1O)O)[C@H](CO)O)C)O |
| Number of orbitals | 544 |
| Number of virtual orbitals | 421 |
| Standard InChI | InChI=1S/C20H32N2O10/c1-7-3-9(21-19-15(29)13(27)17(31-19)11(25)5-23)10(4-8(7)2)22-20-16(30)14(28)18(32-20)12(26)6-24/h3-4,11-30H,5-6H2,1-2H3/t11-,12+,13-,14+,15-,16+,17-,18+,19-,20-/m0/s1 |
| Total Energy | -1632.830841 |
| Entropy | 3.329868D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1632.829897 |
| Standard InChI Key | InChIKey=GHYMWNBYPHIPHA-YHYRBQJMSA-N |
| Final Isomeric SMILES | C[C]1[CH][C](N[C@H]2O[C@@H]([C@@H](O)CO)[C@@H](O)[C@@H]2O)[C]([CH][C]1C)N[C@H]3O[C@H]([C@H](O)CO)[C@H](O)[C@H]3O |
| SMILES | OC[C@H]([C@H]1O[C@@H]([C@@H]([C@H]1O)O)N[C]1[CH][C]([C]([CH][C]1N[C@H]1O[C@H]([C@H]([C@@H]1O)O)[C@H](CO)O)C)C)O |
| Gibbs energy | -1632.929177 |
| Thermal correction to Energy | 0.611825 |
| Thermal correction to Enthalpy | 0.612769 |
| Thermal correction to Gibbs energy | 0.513489 |