| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | Cc1ccc(cc1)/C=C\2/C(=O)N(c3ccccc3S2)CC(=O)NCC[NH+](Cc4ccccc4)C(C)C |
| Molar mass | 500.23717 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 10.06949 |
| Number of basis functions | 612 |
| Zero Point Vibrational Energy | 0.634809 |
| InChI | InChI=1/C30H52N3O2S/c1-22(2)32(20-25-9-5-4-6-10-25)18-17-31-29(34)21-33-26-11-7-8-12-27(26)36-28(30(33)35)19-24-15-13-23(3)14-16-24/h19,22-27,32H,4-18,20-21H2,1-3H3,(H,31,34)/b28-19-/f/h31H |
| Number of occupied orbitals | 133 |
| Energy at 0K | -1865.63413 |
| Input SMILES | O=C(Cn1c(=O)/c(=C/c2ccc(cc2)C)/sc2c1cccc2)NCC[NH+](C(C)C)Cc1ccccc1 |
| Number of orbitals | 612 |
| Number of virtual orbitals | 479 |
| Standard InChI | InChI=1S/C30H52N3O2S/c1-22(2)32(20-25-9-5-4-6-10-25)18-17-31-29(34)21-33-26-11-7-8-12-27(26)36-28(30(33)35)19-24-15-13-23(3)14-16-24/h19,22-27,32H,4-18,20-21H2,1-3H3,(H,31,34)/b28-19- |
| Total Energy | -1865.602299 |
| Entropy | 3.443569D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1865.601355 |
| Standard InChI Key | InChIKey=PQWORMHPWPTBMX-USHMODERSA-N |
| Final Isomeric SMILES | CC1CCC(CC1)/C=C/2SC3CCCCC3N(CC(=O)NCC[NH](CC4CCCCC4)C(C)C)C2=O |
| SMILES | O=C(Cn1c(=O)/c(=C/c2ccc(cc2)C)/sc2c1cccc2)NCC[NH](C(C)C)Cc1ccccc1 |
| Gibbs energy | -1865.704025 |
| Thermal correction to Energy | 0.66664 |
| Thermal correction to Enthalpy | 0.667584 |
| Thermal correction to Gibbs energy | 0.564914 |